Difference between revisions of "Apo-Propionyl-CoA-CO2-ligases"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=IMIDAZOLE-ACETOL-P IMIDAZOLE-ACETOL-P] == * smiles: ** C1(NC=NC=1CC(COP([O-])(=O)[O-])=O) * inc...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Apo-Propionyl-CoA-CO2-ligases Apo-Propionyl-CoA-CO2-ligases] == * common name: ** apo-[propiony...") |
||
(2 intermediate revisions by the same user not shown) | |||
Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
− | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Apo-Propionyl-CoA-CO2-ligases Apo-Propionyl-CoA-CO2-ligases] == |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
* common name: | * common name: | ||
− | ** | + | ** apo-[propionyl-CoA:carbon-dioxide ligase (ADP-forming)] |
− | + | ||
− | + | ||
* Synonym(s): | * Synonym(s): | ||
− | |||
− | |||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | * [[ | + | * [[6.3.4.10-RXN]] |
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
== External links == | == External links == | ||
− | + | {{#set: common name=apo-[propionyl-CoA:carbon-dioxide ligase (ADP-forming)]}} | |
− | + | {{#set: consumed by=6.3.4.10-RXN}} | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | {{#set: | + | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | {{#set: consumed by= | + | |
− | + |
Latest revision as of 20:07, 21 March 2018
Contents
Metabolite Apo-Propionyl-CoA-CO2-ligases
- common name:
- apo-[propionyl-CoA:carbon-dioxide ligase (ADP-forming)]
- Synonym(s):
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"apo-[propionyl-CoA:carbon-dioxide ligase (ADP-forming)" cannot be used as a page name in this wiki.