Difference between revisions of "CPD-16618"

Latest revision as of 20:07, 21 March 2018

"C(C(=O)[O-])C(O)[CH]=O" cannot be used as a page name in this wiki.

@@ Line 1: / Line 1: @@
-[[Category:Gene]]
+[[Category:Metabolite]]
-== Gene Tiso_gene_1365 ==
+== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-16618 CPD-16618] ==
-* left end position:
+* smiles:
-** 6843
+** C(C(=O)[O-])C(O)[CH]=O
-* transcription direction:
+* common name:
-** POSITIVE
+** L-malic semialdehyde
-* right end position:
+* inchi key:
-** 8852
+** InChIKey=QWHDXIUUXWGQME-GSVOUGTGSA-M
-* centisome position:
+* molecular weight:
-** 28.457954
+** 117.081
 * Synonym(s):
+** (3R)-3-hydroxy-4-oxobutanoate
-== Reactions associated ==
+== Reaction(s) known to consume the compound ==
-* [[ATPSYN-RXN]]
+* [[RXN-6002]]
-** in-silico_annotation
+== Reaction(s) known to produce the compound ==
-***ec-number
+== Reaction(s) of unknown directionality ==
-** experimental_annotation
-***ec-number
-== Pathways associated ==
-* [[PWY-7219]]
 == External links  ==
-{{#set: left end position=6843}}
+* PUBCHEM:
-{{#set: transcription direction=POSITIVE}}
+** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=90658049 90658049]
-{{#set: right end position=8852}}
+{{#set: smiles=C(C(=O)[O-])C(O)[CH]=O}}
-{{#set: centisome position=28.457954    }}
+{{#set: common name=L-malic semialdehyde}}
-{{#set: reaction associated=ATPSYN-RXN}}
+{{#set: inchi key=InChIKey=QWHDXIUUXWGQME-GSVOUGTGSA-M}}
-{{#set: pathway associated=PWY-7219}}
+{{#set: molecular weight=117.081    }}
+{{#set: common name=(3R)-3-hydroxy-4-oxobutanoate}}
+{{#set: consumed by=RXN-6002}}