Difference between revisions of "CPD-11410"
From metabolic_network
(Created page with "Category:Gene == Gene Tiso_gene_14056 == * Synonym(s): == Reactions associated == * CARNOSINE-SYNTHASE-RXN ** pantograph-creinhardtii == Pathways associated =...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-11410 CPD-11410] == * smiles: ** C(=O)([O-])CC1(C=C(I)C(=C(I)C=1)OC3(=CC(I)=C(OC2(OC(C([O-]...") |
||
(2 intermediate revisions by the same user not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Metabolite]] |
− | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-11410 CPD-11410] == |
+ | * smiles: | ||
+ | ** C(=O)([O-])CC1(C=C(I)C(=C(I)C=1)OC3(=CC(I)=C(OC2(OC(C([O-])=O)C(O)C(O)C(O)2))C=C3)) | ||
+ | * common name: | ||
+ | ** triiodothyroacetate ether glucuronide | ||
+ | * inchi key: | ||
+ | ** InChIKey=VXVBZMWOWMHXTQ-KFYUBCHVSA-L | ||
+ | * molecular weight: | ||
+ | ** 796.046 | ||
* Synonym(s): | * Synonym(s): | ||
+ | ** triiodothyroacetic acid ether glucuronide | ||
− | == | + | == Reaction(s) known to consume the compound == |
− | * [[ | + | == Reaction(s) known to produce the compound == |
− | + | * [[RXN-10619]] | |
− | == | + | == Reaction(s) of unknown directionality == |
− | + | ||
== External links == | == External links == | ||
− | {{#set: | + | * PUBCHEM: |
− | {{#set: | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=90659025 90659025] |
+ | {{#set: smiles=C(=O)([O-])CC1(C=C(I)C(=C(I)C=1)OC3(=CC(I)=C(OC2(OC(C([O-])=O)C(O)C(O)C(O)2))C=C3))}} | ||
+ | {{#set: common name=triiodothyroacetate ether glucuronide}} | ||
+ | {{#set: inchi key=InChIKey=VXVBZMWOWMHXTQ-KFYUBCHVSA-L}} | ||
+ | {{#set: molecular weight=796.046 }} | ||
+ | {{#set: common name=triiodothyroacetic acid ether glucuronide}} | ||
+ | {{#set: produced by=RXN-10619}} |
Latest revision as of 20:08, 21 March 2018
Contents
Metabolite CPD-11410
- smiles:
- C(=O)([O-])CC1(C=C(I)C(=C(I)C=1)OC3(=CC(I)=C(OC2(OC(C([O-])=O)C(O)C(O)C(O)2))C=C3))
- common name:
- triiodothyroacetate ether glucuronide
- inchi key:
- InChIKey=VXVBZMWOWMHXTQ-KFYUBCHVSA-L
- molecular weight:
- 796.046
- Synonym(s):
- triiodothyroacetic acid ether glucuronide
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
- PUBCHEM:
"C(=O)([O-])CC1(C=C(I)C(=C(I)C=1)OC3(=CC(I)=C(OC2(OC(C([O-])=O)C(O)C(O)C(O)2))C=C3))" cannot be used as a page name in this wiki.