Difference between revisions of "CPD-18761"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-13377 CPD-13377] == * smiles: ** C8(C(C(C(C(OCC7(OC(OC3(C(O)C(O)C(OC(COC1(C(C(C(CO1)O)O)OC2...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-18761 CPD-18761] == * smiles: ** COC1(=CC(=CCCO)C=CC(=O)1) * common name: ** coniferyl alco...") |
||
| (2 intermediate revisions by the same user not shown) | |||
| Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
| − | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD- | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-18761 CPD-18761] == |
* smiles: | * smiles: | ||
| − | ** | + | ** COC1(=CC(=CCCO)C=CC(=O)1) |
| − | + | ||
| − | + | ||
* common name: | * common name: | ||
| − | ** | + | ** coniferyl alcohol radical |
| + | * inchi key: | ||
| + | ** InChIKey=ORAJWSYKRGVTDP-UHFFFAOYSA-N | ||
* molecular weight: | * molecular weight: | ||
| − | ** | + | ** 179.195 |
* Synonym(s): | * Synonym(s): | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| + | * [[RXN-17352]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
== External links == | == External links == | ||
| − | + | {{#set: smiles=COC1(=CC(=CCCO)C=CC(=O)1)}} | |
| − | + | {{#set: common name=coniferyl alcohol radical}} | |
| − | {{#set: smiles= | + | {{#set: inchi key=InChIKey=ORAJWSYKRGVTDP-UHFFFAOYSA-N}} |
| − | {{#set: | + | {{#set: molecular weight=179.195 }} |
| − | {{#set: | + | {{#set: produced by=RXN-17352}} |
| − | {{#set: molecular weight= | + | |
| − | {{#set: | + | |
Latest revision as of 20:08, 21 March 2018
Contents
Metabolite CPD-18761
- smiles:
- COC1(=CC(=CCCO)C=CC(=O)1)
- common name:
- coniferyl alcohol radical
- inchi key:
- InChIKey=ORAJWSYKRGVTDP-UHFFFAOYSA-N
- molecular weight:
- 179.195
- Synonym(s):
