Difference between revisions of "CPDQT-29"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CYS-tRNAs CYS-tRNAs] == * common name: ** a tRNAcys * Synonym(s): ** TRNA(CYS) == Reaction(s)...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPDQT-29 CPDQT-29] == * smiles: ** CSCCCCCCC(=O)C([O-])=O * common name: ** 8-(methylthio)-2-ox...") |
||
(2 intermediate revisions by the same user not shown) | |||
Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
− | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPDQT-29 CPDQT-29] == |
+ | * smiles: | ||
+ | ** CSCCCCCCC(=O)C([O-])=O | ||
* common name: | * common name: | ||
− | ** | + | ** 8-(methylthio)-2-oxooctanoate |
+ | * inchi key: | ||
+ | ** InChIKey=QDZNKMGEHAHOTA-UHFFFAOYSA-M | ||
+ | * molecular weight: | ||
+ | ** 203.276 | ||
* Synonym(s): | * Synonym(s): | ||
− | ** | + | ** 8-(methylthio)-2-oxooctanoic acid |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | * [[RXN- | + | * [[RXN-18205]] |
+ | * [[RXNQT-4171]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
== External links == | == External links == | ||
− | {{#set: | + | * PUBCHEM: |
− | {{#set: common name= | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=44237313 44237313] |
− | {{#set: | + | * KNAPSACK : C00007643 |
− | {{#set: produced by=RXN- | + | {{#set: smiles=CSCCCCCCC(=O)C([O-])=O}} |
+ | {{#set: common name=8-(methylthio)-2-oxooctanoate}} | ||
+ | {{#set: inchi key=InChIKey=QDZNKMGEHAHOTA-UHFFFAOYSA-M}} | ||
+ | {{#set: molecular weight=203.276 }} | ||
+ | {{#set: common name=8-(methylthio)-2-oxooctanoic acid}} | ||
+ | {{#set: produced by=RXN-18205|RXNQT-4171}} |
Latest revision as of 20:08, 21 March 2018
Contents
Metabolite CPDQT-29
- smiles:
- CSCCCCCCC(=O)C([O-])=O
- common name:
- 8-(methylthio)-2-oxooctanoate
- inchi key:
- InChIKey=QDZNKMGEHAHOTA-UHFFFAOYSA-M
- molecular weight:
- 203.276
- Synonym(s):
- 8-(methylthio)-2-oxooctanoic acid
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
- PUBCHEM:
- KNAPSACK : C00007643
"CSCCCCCCC(=O)C([O-])=O" cannot be used as a page name in this wiki.