Difference between revisions of "CPD-19492"
From metabolic_network
(Created page with "Category:Gene == Gene Tiso_gene_16772 == * left end position: ** 376 * transcription direction: ** POSITIVE * right end position: ** 1379 * centisome position: ** 9.106321...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-19492 CPD-19492] == * smiles: ** CCC(C([O-])=O)C(C(=O)[O-])=O * common name: ** 3-ethyl-2-o...") |
||
| (2 intermediate revisions by the same user not shown) | |||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:Metabolite]] |
| − | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-19492 CPD-19492] == |
| − | * | + | * smiles: |
| − | ** | + | ** CCC(C([O-])=O)C(C(=O)[O-])=O |
| − | * | + | * common name: |
| − | ** | + | ** 3-ethyl-2-oxosuccinate |
| − | * | + | * inchi key: |
| − | ** | + | ** InChIKey=OUGLPIHDPBRSID-UHFFFAOYSA-L |
| − | * | + | * molecular weight: |
| − | ** | + | ** 158.11 |
* Synonym(s): | * Synonym(s): | ||
| − | == | + | == Reaction(s) known to consume the compound == |
| − | * [[ | + | * [[RXN-18211]] |
| − | + | == Reaction(s) known to produce the compound == | |
| − | + | == Reaction(s) of unknown directionality == | |
| − | + | * [[RXN-18210]] | |
| − | + | ||
| − | + | ||
| − | + | ||
| − | == | + | |
| − | * [[ | + | |
| − | + | ||
== External links == | == External links == | ||
| − | {{#set: | + | {{#set: smiles=CCC(C([O-])=O)C(C(=O)[O-])=O}} |
| − | {{#set: | + | {{#set: common name=3-ethyl-2-oxosuccinate}} |
| − | {{#set: | + | {{#set: inchi key=InChIKey=OUGLPIHDPBRSID-UHFFFAOYSA-L}} |
| − | {{#set: | + | {{#set: molecular weight=158.11 }} |
| − | {{#set: | + | {{#set: consumed by=RXN-18211}} |
| − | {{#set: | + | {{#set: reversible reaction associated=RXN-18210}} |
Latest revision as of 21:08, 21 March 2018
Contents
Metabolite CPD-19492
- smiles:
- CCC(C([O-])=O)C(C(=O)[O-])=O
- common name:
- 3-ethyl-2-oxosuccinate
- inchi key:
- InChIKey=OUGLPIHDPBRSID-UHFFFAOYSA-L
- molecular weight:
- 158.11
- Synonym(s):
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"CCC(C([O-])=O)C(C(=O)[O-])=O" cannot be used as a page name in this wiki.
