Difference between revisions of "CPD-7649"
From metabolic_network
(Created page with "Category:Gene == Gene Tiso_gene_12611 == * left end position: ** 21 * transcription direction: ** POSITIVE * right end position: ** 6732 * centisome position: ** 0.3074670...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-7649 CPD-7649] == * smiles: ** C1(=C(CC[N+])C=C(OS(=O)(=O)[O-])C(O)=C1) * common name: ** d...") |
||
| (3 intermediate revisions by the same user not shown) | |||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:Metabolite]] |
| − | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-7649 CPD-7649] == |
| − | * | + | * smiles: |
| − | ** | + | ** C1(=C(CC[N+])C=C(OS(=O)(=O)[O-])C(O)=C1) |
| − | * | + | * common name: |
| − | ** | + | ** dopamine 3-O-sulfate |
| − | * | + | * inchi key: |
| − | ** | + | ** InChIKey=NZKRYJGNYPYXJZ-UHFFFAOYSA-N |
| − | * | + | * molecular weight: |
| − | ** | + | ** 233.239 |
* Synonym(s): | * Synonym(s): | ||
| + | ** 5-(2-aminoethyl)-2-hydroxyphenyl hydrogen sulfate | ||
| + | ** 4-(2-aminoethyl)-1,2-benzenediol 2-(hydrogen sulfate) | ||
| − | == | + | == Reaction(s) known to consume the compound == |
| − | + | == Reaction(s) known to produce the compound == | |
| − | + | * [[RXN6666-9]] | |
| − | + | == Reaction(s) of unknown directionality == | |
| − | * [[ | + | |
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | == | + | |
| − | + | ||
== External links == | == External links == | ||
| − | {{#set: | + | * LIGAND-CPD: |
| − | {{#set: | + | ** [http://www.genome.jp/dbget-bin/www_bget?C13690 C13690] |
| − | {{#set: | + | * HMDB : HMDB06275 |
| − | {{#set: | + | * CHEBI: |
| − | {{#set: | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=133524 133524] |
| − | {{#set: | + | * METABOLIGHTS : MTBLC37946 |
| + | * PUBCHEM: | ||
| + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25201578 25201578] | ||
| + | {{#set: smiles=C1(=C(CC[N+])C=C(OS(=O)(=O)[O-])C(O)=C1)}} | ||
| + | {{#set: common name=dopamine 3-O-sulfate}} | ||
| + | {{#set: inchi key=InChIKey=NZKRYJGNYPYXJZ-UHFFFAOYSA-N}} | ||
| + | {{#set: molecular weight=233.239 }} | ||
| + | {{#set: common name=5-(2-aminoethyl)-2-hydroxyphenyl hydrogen sulfate|4-(2-aminoethyl)-1,2-benzenediol 2-(hydrogen sulfate)}} | ||
| + | {{#set: produced by=RXN6666-9}} | ||
Latest revision as of 19:19, 21 March 2018
Contents
Metabolite CPD-7649
- smiles:
- C1(=C(CC[N+])C=C(OS(=O)(=O)[O-])C(O)=C1)
- common name:
- dopamine 3-O-sulfate
- inchi key:
- InChIKey=NZKRYJGNYPYXJZ-UHFFFAOYSA-N
- molecular weight:
- 233.239
- Synonym(s):
- 5-(2-aminoethyl)-2-hydroxyphenyl hydrogen sulfate
- 4-(2-aminoethyl)-1,2-benzenediol 2-(hydrogen sulfate)
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"C1(=C(CC[N+])C=C(OS(=O)(=O)[O-])C(O)=C1)" cannot be used as a page name in this wiki.
