Difference between revisions of "Peptides-with-Leader-Sequence"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-19492 CPD-19492] == * smiles: ** CCC(C([O-])=O)C(C(=O)[O-])=O * inchi key: ** InChIKey=OUGL...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Peptides-with-Leader-Sequence Peptides-with-Leader-Sequence] == * common name: ** a peptide wit...") |
||
| (2 intermediate revisions by the same user not shown) | |||
| Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
| − | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Peptides-with-Leader-Sequence Peptides-with-Leader-Sequence] == |
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
* common name: | * common name: | ||
| − | ** | + | ** a peptide with a leader sequence |
| − | + | ||
| − | + | ||
* Synonym(s): | * Synonym(s): | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[ | + | * [[3.4.21.89-RXN]] |
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | |||
== External links == | == External links == | ||
| − | + | {{#set: common name=a peptide with a leader sequence}} | |
| − | + | {{#set: consumed by=3.4.21.89-RXN}} | |
| − | {{#set: common name= | + | |
| − | + | ||
| − | {{#set: consumed by= | + | |
| − | + | ||
Latest revision as of 20:09, 21 March 2018
Contents
Metabolite Peptides-with-Leader-Sequence
- common name:
- a peptide with a leader sequence
- Synonym(s):
