Difference between revisions of "CPD-13575"
From metabolic_network
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=ExchangeSeed_Light ExchangeSeed_Light] == * direction: ** REVERSIBLE * Synonym(s): == Reaction For...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-13575 CPD-13575] == * smiles: ** CC1(C(=CCOP([O-])(=O)[O-])SC(C(=O)[O-])N=1) * common name:...") |
||
| (2 intermediate revisions by the same user not shown) | |||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:Metabolite]] |
| − | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-13575 CPD-13575] == |
| − | * | + | * smiles: |
| − | ** | + | ** CC1(C(=CCOP([O-])(=O)[O-])SC(C(=O)[O-])N=1) |
| + | * common name: | ||
| + | ** 2-[(2R,5Z)-2-carboxy-4-methylthiazol-5(2H)-ylidene]ethyl phosphate | ||
| + | * inchi key: | ||
| + | ** InChIKey=PQMCQNOVNFNPFJ-HYIMLASBSA-K | ||
| + | * molecular weight: | ||
| + | ** 264.169 | ||
* Synonym(s): | * Synonym(s): | ||
| + | ** cThz*-P | ||
| + | ** thiazole tautomer | ||
| + | ** (R,Z)-2-(2-carboxy-4-methylthiazol-5(2H)-ylidene)ethyl phosphate | ||
| − | == Reaction | + | == Reaction(s) known to consume the compound == |
| − | * | + | * [[RXN-12611]] |
| − | + | == Reaction(s) known to produce the compound == | |
| − | + | == Reaction(s) of unknown directionality == | |
| − | + | ||
| − | + | ||
| − | + | ||
| − | == | + | |
| − | + | ||
| − | + | ||
| − | + | ||
== External links == | == External links == | ||
| − | {{#set: | + | * PUBCHEM: |
| − | {{#set: | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=53477654 53477654] |
| − | {{#set: | + | * CHEBI: |
| − | {{#set: | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=62899 62899] |
| + | {{#set: smiles=CC1(C(=CCOP([O-])(=O)[O-])SC(C(=O)[O-])N=1)}} | ||
| + | {{#set: common name=2-[(2R,5Z)-2-carboxy-4-methylthiazol-5(2H)-ylidene]ethyl phosphate}} | ||
| + | {{#set: inchi key=InChIKey=PQMCQNOVNFNPFJ-HYIMLASBSA-K}} | ||
| + | {{#set: molecular weight=264.169 }} | ||
| + | {{#set: common name=cThz*-P|thiazole tautomer|(R,Z)-2-(2-carboxy-4-methylthiazol-5(2H)-ylidene)ethyl phosphate}} | ||
| + | {{#set: consumed by=RXN-12611}} | ||
Latest revision as of 20:09, 21 March 2018
Contents
Metabolite CPD-13575
- smiles:
- CC1(C(=CCOP([O-])(=O)[O-])SC(C(=O)[O-])N=1)
- common name:
- 2-[(2R,5Z)-2-carboxy-4-methylthiazol-5(2H)-ylidene]ethyl phosphate
- inchi key:
- InChIKey=PQMCQNOVNFNPFJ-HYIMLASBSA-K
- molecular weight:
- 264.169
- Synonym(s):
- cThz*-P
- thiazole tautomer
- (R,Z)-2-(2-carboxy-4-methylthiazol-5(2H)-ylidene)ethyl phosphate
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"CC1(C(=CCOP([O-])(=O)[O-])SC(C(=O)[O-])N=1)" cannot be used as a page name in this wiki.
"2-[(2R,5Z)-2-carboxy-4-methylthiazol-5(2H)-ylidene]ethyl phosphate" cannot be used as a page name in this wiki.
