Difference between revisions of "RXN-14274"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=DIVINYL-PROTOCHLOROPHYLLIDE-A DIVINYL-PROTOCHLOROPHYLLIDE-A] == * smiles: ** C=CC2(C(C)=C4(C=C9...")
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-14274 RXN-14274] == * direction: ** REVERSIBLE * common name: ** decanoyl-CoA C-acyltransferase...")
 
(2 intermediate revisions by the same user not shown)
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Reaction]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=DIVINYL-PROTOCHLOROPHYLLIDE-A DIVINYL-PROTOCHLOROPHYLLIDE-A] ==
+
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-14274 RXN-14274] ==
−
* smiles:
+
* direction:
−
** C=CC2(C(C)=C4(C=C9(C(C)=C(CCC(=O)[O-])C5(=N([Mg]36(N1(=C(C(C=C)=C(C)C1=CC=2N34)C=C7(C(C)=C8(C(=O)[C-](C(OC)=O)C5=C(N67)8)))))9))))
+
** REVERSIBLE
 
* common name:
 
* common name:
−
** 3,8-divinyl protochlorophyllide a
+
** decanoyl-CoA C-acyltransferase
−
* molecular weight:
+
** acetyl-_c-acetyltransferase
−
** 608.935   
+
** 3-ketoacyl-_thiolase
 +
** thiolase
 +
* ec number:
 +
** [http://enzyme.expasy.org/EC/2.3.1.16 EC-2.3.1.16]
 
* Synonym(s):
 
* Synonym(s):
−
** divinylprotochlorophyllide
 
  
−
== Reaction(s) known to consume the compound ==
+
== Reaction Formula ==
−
* [[RXN-5285]]
+
* With identifiers:
−
== Reaction(s) known to produce the compound ==
+
** 1 [[ACETYL-COA]][c] '''+''' 1 [[CPD-10267]][c] '''<=>''' 1 [[CPD0-2105]][c] '''+''' 1 [[CO-A]][c]
−
* [[RXN-5284]]
+
* With common name(s):
−
== Reaction(s) of unknown directionality ==
+
** 1 acetyl-CoA[c] '''+''' 1 decanoyl-CoA[c] '''<=>''' 1 3-oxododecanoyl-CoA[c] '''+''' 1 coenzyme A[c]
−
* [[RXN-17487]]
+
 
 +
== Genes associated with this reaction  ==
 +
Genes have been associated with this reaction based on different elements listed below.
 +
* Gene: [[Tiso_gene_3855]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Assignment: EC-NUMBER
 +
** Source: [[annotation-experimental_annotation]]
 +
*** Assignment: EC-NUMBER
 +
* Gene: [[Tiso_gene_17451]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Assignment: EC-NUMBER
 +
** Source: [[annotation-experimental_annotation]]
 +
*** Assignment: EC-NUMBER
 +
* Gene: [[Tiso_gene_3856]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Assignment: EC-NUMBER
 +
* Gene: [[Tiso_gene_15327]]
 +
** Source: [[annotation-experimental_annotation]]
 +
*** Assignment: EC-NUMBER
 +
* Gene: [[Tiso_gene_10116]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Assignment: EC-NUMBER
 +
** Source: [[annotation-experimental_annotation]]
 +
*** Assignment: EC-NUMBER
 +
* Gene: [[Tiso_gene_16181]]
 +
** Source: [[orthology-athaliana]]
 +
** Source: [[orthology-esiliculosus]]
 +
== Pathways  ==
 +
== Reconstruction information  ==
 +
* Category: [[orthology]]
 +
** Source: [[orthology-athaliana]]
 +
*** Tool: [[pantograph]]
 +
** Source: [[orthology-esiliculosus]]
 +
*** Tool: [[pantograph]]
 +
* Category: [[annotation]]
 +
** Source: [[annotation-experimental_annotation]]
 +
*** Tool: [[pathwaytools]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Tool: [[pathwaytools]]
 
== External links  ==
 
== External links  ==
−
* PUBCHEM:
+
* RHEA:
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=54743931 54743931]
+
** [http://www.ebi.ac.uk/rhea/reaction.xhtml?id=31185 31185]
−
* CHEBI:
+
* LIGAND-RXN:
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=58632 58632]
+
** [http://www.genome.jp/dbget-bin/www_bget?R04742 R04742]
−
* LIGAND-CPD:
+
{{#set: direction=REVERSIBLE}}
−
** [http://www.genome.jp/dbget-bin/www_bget?C11831 C11831]
+
{{#set: common name=decanoyl-CoA C-acyltransferase}}
−
{{#set: smiles=C=CC2(C(C)=C4(C=C9(C(C)=C(CCC(=O)[O-])C5(=N([Mg]36(N1(=C(C(C=C)=C(C)C1=CC=2N34)C=C7(C(C)=C8(C(=O)[C-](C(OC)=O)C5=C(N67)8)))))9))))}}
+
{{#set: common name=acetyl-_c-acetyltransferase}}
−
{{#set: common name=3,8-divinyl protochlorophyllide a}}
+
{{#set: common name=3-ketoacyl-_thiolase}}
−
{{#set: molecular weight=608.935    }}
+
{{#set: common name=thiolase}}
−
{{#set: common name=divinylprotochlorophyllide}}
+
{{#set: ec number=EC-2.3.1.16}}
−
{{#set: consumed by=RXN-5285}}
+
{{#set: gene associated=Tiso_gene_3855|Tiso_gene_17451|Tiso_gene_3856|Tiso_gene_15327|Tiso_gene_10116|Tiso_gene_16181}}
−
{{#set: produced by=RXN-5284}}
+
{{#set: in pathway=}}
−
{{#set: consumed or produced by=RXN-17487}}
+
{{#set: reconstruction category=orthology|annotation}}
 +
{{#set: reconstruction source=annotation-experimental_annotation|orthology-athaliana|annotation-in-silico_annotation|orthology-esiliculosus}}
 +
{{#set: reconstruction tool=pantograph|pathwaytools}}

Latest revision as of 20:09, 21 March 2018

Reaction RXN-14274

  • direction:
    • REVERSIBLE
  • common name:
    • decanoyl-CoA C-acyltransferase
    • acetyl-_c-acetyltransferase
    • 3-ketoacyl-_thiolase
    • thiolase
  • ec number:
  • Synonym(s):

Reaction Formula

  • With identifiers:
  • With common name(s):
    • 1 acetyl-CoA[c] + 1 decanoyl-CoA[c] <=> 1 3-oxododecanoyl-CoA[c] + 1 coenzyme A[c]

Genes associated with this reaction

Genes have been associated with this reaction based on different elements listed below.

Pathways

Reconstruction information

External links






Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=RXN-14274&oldid=46417"