Difference between revisions of "CPD-308"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-8348 RXN-8348] == * direction: ** LEFT-TO-RIGHT * ec number: ** [http://enzyme.expasy.org/EC/2....")
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-308 CPD-308] == * smiles: ** C([O-])(=O)CCC([N+]C(C(=O)[O-])CCCNC(N)=[N+])C([O-])=O * commo...")
 
(2 intermediate revisions by the same user not shown)
Line 1: Line 1:
−
[[Category:Reaction]]
+
[[Category:Metabolite]]
−
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-8348 RXN-8348] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-308 CPD-308] ==
−
* direction:
+
* smiles:
−
** LEFT-TO-RIGHT
+
** C([O-])(=O)CCC([N+]C(C(=O)[O-])CCCNC(N)=[N+])C([O-])=O
−
* ec number:
+
* common name:
−
** [http://enzyme.expasy.org/EC/2.10.1.1 EC-2.10.1.1]
+
** D-nopaline
 +
* inchi key:
 +
** InChIKey=LMKYZBGVKHTLTN-NKWVEPMBSA-M
 +
* molecular weight:
 +
** 303.294   
 
* Synonym(s):
 
* Synonym(s):
 +
** N2-(D-1,3-dicarboxypropyl)-L-arginine
  
−
== Reaction Formula ==
+
== Reaction(s) known to consume the compound ==
−
* With identifiers:
+
== Reaction(s) known to produce the compound ==
−
** 1 [[CPD-8122]][c] '''+''' 1 [[PROTON]][c] '''+''' 1 [[CPD-3]][c] '''=>''' 1 [[WATER]][c] '''+''' 1 [[CPD-8123]][c] '''+''' 1 [[AMP]][c]
+
* [[1.5.1.19-RXN]]
−
* With common name(s):
+
== Reaction(s) of unknown directionality ==
−
** 1 molybdopterin adenine dinucleotide[c] '''+''' 1 H+[c] '''+''' 1 molybdate[c] '''=>''' 1 H2O[c] '''+''' 1 MoO2-molybdopterin cofactor[c] '''+''' 1 AMP[c]
+
−
 
+
−
== Genes associated with this reaction  ==
+
−
Genes have been associated with this reaction based on different elements listed below.
+
−
* [[Tiso_gene_17329]]
+
−
** [[pantograph]]-[[esiliculosus]]
+
−
== Pathways  ==
+
−
* [[PWY-6823]], molybdenum cofactor biosynthesis: [http://metacyc.org/META/NEW-IMAGE?object=PWY-6823 PWY-6823]
+
−
** '''3''' reactions found over '''8''' reactions in the full pathway
+
−
== Reconstruction information  ==
+
−
* [[orthology]]:
+
−
** [[pantograph]]:
+
−
*** [[esiliculosus]]
+
 
== External links  ==
 
== External links  ==
−
* LIGAND-RXN:
+
* PUBCHEM:
−
** [http://www.genome.jp/dbget-bin/www_bget?R09735 R09735]
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=49791983 49791983]
−
{{#set: direction=LEFT-TO-RIGHT}}
+
* CHEBI:
−
{{#set: ec number=EC-2.10.1.1}}
+
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=58074 58074]
−
{{#set: gene associated=Tiso_gene_17329}}
+
* LIGAND-CPD:
−
{{#set: in pathway=PWY-6823}}
+
** [http://www.genome.jp/dbget-bin/www_bget?C01682 C01682]
−
{{#set: reconstruction category=orthology}}
+
{{#set: smiles=C([O-])(=O)CCC([N+]C(C(=O)[O-])CCCNC(N)=[N+])C([O-])=O}}
−
{{#set: reconstruction tool=pantograph}}
+
{{#set: common name=D-nopaline}}
−
{{#set: reconstruction source=esiliculosus}}
+
{{#set: inchi key=InChIKey=LMKYZBGVKHTLTN-NKWVEPMBSA-M}}
 +
{{#set: molecular weight=303.294    }}
 +
{{#set: common name=N2-(D-1,3-dicarboxypropyl)-L-arginine}}
 +
{{#set: produced by=1.5.1.19-RXN}}

Latest revision as of 20:09, 21 March 2018

Metabolite CPD-308

  • smiles:
    • C([O-])(=O)CCC([N+]C(C(=O)[O-])CCCNC(N)=[N+])C([O-])=O
  • common name:
    • D-nopaline
  • inchi key:
    • InChIKey=LMKYZBGVKHTLTN-NKWVEPMBSA-M
  • molecular weight:
    • 303.294
  • Synonym(s):
    • N2-(D-1,3-dicarboxypropyl)-L-arginine

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"C([O-])(=O)CCC([N+]C(C(=O)[O-])CCCNC(N)=[N+])C([O-])=O" cannot be used as a page name in this wiki.



Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=CPD-308&oldid=46422"