Difference between revisions of "CPD-15104"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=N-ACETYLTRANSFER-RXN N-ACETYLTRANSFER-RXN] == * direction: ** REVERSIBLE * common name: ** n-acetyl...")
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-15104 CPD-15104] == * smiles: ** CCC(O)(C)C(=O)C(=O)[O-] * common name: ** (R)-3-hydroxy-3-...")
 
(2 intermediate revisions by the same user not shown)
Line 1: Line 1:
−
[[Category:Reaction]]
+
[[Category:Metabolite]]
−
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=N-ACETYLTRANSFER-RXN N-ACETYLTRANSFER-RXN] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-15104 CPD-15104] ==
−
* direction:
+
* smiles:
−
** REVERSIBLE
+
** CCC(O)(C)C(=O)C(=O)[O-]
 
* common name:
 
* common name:
−
** n-acetylglutamate_synthase
+
** (R)-3-hydroxy-3-methyl-2-oxopentanoate
−
* ec number:
+
* inchi key:
−
** [http://enzyme.expasy.org/EC/2.3.1.1 EC-2.3.1.1]
+
** InChIKey=YJVOWRAWFXRESP-ZCFIWIBFSA-M
 +
* molecular weight:
 +
** 145.135   
 
* Synonym(s):
 
* Synonym(s):
  
−
== Reaction Formula ==
+
== Reaction(s) known to consume the compound ==
−
* With identifiers:
+
* [[R05068]]
−
** 1 [[ACETYL-COA]][c] '''+''' 1 [[GLT]][c] '''<=>''' 1 [[CO-A]][c] '''+''' 1 [[ACETYL-GLU]][c] '''+''' 1 [[PROTON]][c]
+
== Reaction(s) known to produce the compound ==
−
* With common name(s):
+
== Reaction(s) of unknown directionality ==
−
** 1 acetyl-CoA[c] '''+''' 1 L-glutamate[c] '''<=>''' 1 coenzyme A[c] '''+''' 1 N-acetyl-L-glutamate[c] '''+''' 1 H+[c]
+
* [[RXN-14106]]
−
 
+
−
== Genes associated with this reaction  ==
+
−
Genes have been associated with this reaction based on different elements listed below.
+
−
* [[Tiso_gene_5365]]
+
−
** IN-SILICO_ANNOTATION
+
−
***AUTOMATED-NAME-MATCH
+
−
* [[Tiso_gene_11663]]
+
−
** [[pantograph]]-[[athaliana]]
+
−
** [[pantograph]]-[[synechocystis]]
+
−
** [[pantograph]]-[[esiliculosus]]
+
−
== Pathways  ==
+
−
* [[PWY-5154]], L-arginine biosynthesis III (via N-acetyl-L-citrulline): [http://metacyc.org/META/NEW-IMAGE?object=PWY-5154 PWY-5154]
+
−
** '''7''' reactions found over '''9''' reactions in the full pathway
+
−
* [[GLUTORN-PWY]], L-ornithine biosynthesis I: [http://metacyc.org/META/NEW-IMAGE?object=GLUTORN-PWY GLUTORN-PWY]
+
−
** '''5''' reactions found over '''5''' reactions in the full pathway
+
−
* [[ARGSYNBSUB-PWY]], L-arginine biosynthesis II (acetyl cycle): [http://metacyc.org/META/NEW-IMAGE?object=ARGSYNBSUB-PWY ARGSYNBSUB-PWY]
+
−
** '''9''' reactions found over '''9''' reactions in the full pathway
+
−
== Reconstruction information  ==
+
−
* [[orthology]]:
+
−
** [[pantograph]]:
+
−
*** [[synechocystis]]
+
−
*** [[athaliana]]
+
−
*** [[esiliculosus]]
+
−
* [[annotation]]:
+
−
** [[pathwaytools]]:
+
−
*** [[in-silico_annotation]]
+
 
== External links  ==
 
== External links  ==
−
* RHEA:
+
* PUBCHEM:
−
** [http://www.ebi.ac.uk/rhea/reaction.xhtml?id=24292 24292]
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=20846131 20846131]
−
* LIGAND-RXN:
+
* CHEBI:
−
** [http://www.genome.jp/dbget-bin/www_bget?R00259 R00259]
+
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=49257 49257]
−
* UNIPROT:
+
* LIGAND-CPD:
−
** [http://www.uniprot.org/uniprot/Q9JW21 Q9JW21]
+
** [http://www.genome.jp/dbget-bin/www_bget?C14463 C14463]
−
** [http://www.uniprot.org/uniprot/P63574 P63574]
+
{{#set: smiles=CCC(O)(C)C(=O)C(=O)[O-]}}
−
** [http://www.uniprot.org/uniprot/Q12643 Q12643]
+
{{#set: common name=(R)-3-hydroxy-3-methyl-2-oxopentanoate}}
−
** [http://www.uniprot.org/uniprot/P0A6C5 P0A6C5]
+
{{#set: inchi key=InChIKey=YJVOWRAWFXRESP-ZCFIWIBFSA-M}}
−
{{#set: direction=REVERSIBLE}}
+
{{#set: molecular weight=145.135    }}
−
{{#set: common name=n-acetylglutamate_synthase}}
+
{{#set: consumed by=R05068}}
−
{{#set: ec number=EC-2.3.1.1}}
+
{{#set: reversible reaction associated=RXN-14106}}
−
{{#set: gene associated=Tiso_gene_5365|Tiso_gene_11663}}
+
−
{{#set: in pathway=PWY-5154|GLUTORN-PWY|ARGSYNBSUB-PWY}}
+
−
{{#set: reconstruction category=orthology}}
+
−
{{#set: reconstruction tool=pantograph}}
+
−
{{#set: reconstruction source=synechocystis|athaliana|esiliculosus}}
+
−
{{#set: reconstruction category=annotation}}
+
−
{{#set: reconstruction tool=pathwaytools}}
+
−
{{#set: reconstruction source=in-silico_annotation}}
+

Latest revision as of 20:10, 21 March 2018

Metabolite CPD-15104

  • smiles:
    • CCC(O)(C)C(=O)C(=O)[O-]
  • common name:
    • (R)-3-hydroxy-3-methyl-2-oxopentanoate
  • inchi key:
    • InChIKey=YJVOWRAWFXRESP-ZCFIWIBFSA-M
  • molecular weight:
    • 145.135
  • Synonym(s):

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"CCC(O)(C)C(=O)C(=O)[O-" cannot be used as a page name in this wiki.



Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=CPD-15104&oldid=46516"