Difference between revisions of "DIHYDROXY-BUTANONE-P"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-14048 RXN-14048] == * direction: ** LEFT-TO-RIGHT * Synonym(s): == Reaction Formula == * With...")
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=DIHYDROXY-BUTANONE-P DIHYDROXY-BUTANONE-P] == * smiles: ** CC(=O)C(O)COP(=O)([O-])[O-] * common...")
 
(2 intermediate revisions by the same user not shown)
Line 1: Line 1:
−
[[Category:Reaction]]
+
[[Category:Metabolite]]
−
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-14048 RXN-14048] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=DIHYDROXY-BUTANONE-P DIHYDROXY-BUTANONE-P] ==
−
* direction:
+
* smiles:
−
** LEFT-TO-RIGHT
+
** CC(=O)C(O)COP(=O)([O-])[O-]
 +
* common name:
 +
** 1-deoxy-L-glycero-tetrulose 4-phosphate
 +
* inchi key:
 +
** InChIKey=OKYHYXLCTGGOLM-SCSAIBSYSA-L
 +
* molecular weight:
 +
** 182.069   
 
* Synonym(s):
 
* Synonym(s):
 +
** 3,4-dihydroxy-2-butanone-4-phosphate
 +
** tetrolose phosphate
 +
** 3,4-dihydroxy-2-butanone-4-P
 +
** L-3,4-dihydroxybutan-2-one-4-phosphate
  
−
== Reaction Formula ==
+
== Reaction(s) known to consume the compound ==
−
* With identifiers:
+
== Reaction(s) known to produce the compound ==
−
** 1 [[L-CYSTATHIONINE]][c] '''=>''' 1 [[CYS]][c] '''+''' 1 [[CPD-15056]][c] '''+''' 1 [[PROTON]][c]
+
* [[DIOHBUTANONEPSYN-RXN]]
−
* With common name(s):
+
== Reaction(s) of unknown directionality ==
−
** 1 L-cystathionine[c] '''=>''' 1 L-cysteine[c] '''+''' 1 (2Z)-2-aminobut-2-enoate[c] '''+''' 1 H+[c]
+
−
 
+
−
== Genes associated with this reaction  ==
+
−
Genes have been associated with this reaction based on different elements listed below.
+
−
* [[Tiso_gene_3732]]
+
−
** [[pantograph]]-[[esiliculosus]]
+
−
== Pathways  ==
+
−
* [[HOMOCYSDEGR-PWY]], L-cysteine biosynthesis III (from L-homocysteine): [http://metacyc.org/META/NEW-IMAGE?object=HOMOCYSDEGR-PWY HOMOCYSDEGR-PWY]
+
−
** '''4''' reactions found over '''4''' reactions in the full pathway
+
−
* [[PWY-801]], L-homocysteine and L-cysteine interconversion: [http://metacyc.org/META/NEW-IMAGE?object=PWY-801 PWY-801]
+
−
** '''3''' reactions found over '''3''' reactions in the full pathway
+
−
== Reconstruction information  ==
+
−
* [[orthology]]:
+
−
** [[pantograph]]:
+
−
*** [[esiliculosus]]
+
 
== External links  ==
 
== External links  ==
−
* RHEA:
+
* PUBCHEM:
−
** [http://www.ebi.ac.uk/rhea/reaction.xhtml?id=24913 24913]
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=90658385 90658385]
−
{{#set: direction=LEFT-TO-RIGHT}}
+
* CHEMSPIDER:
−
{{#set: gene associated=Tiso_gene_3732}}
+
** [http://www.chemspider.com/Chemical-Structure.10739351.html 10739351]
−
{{#set: in pathway=HOMOCYSDEGR-PWY|PWY-801}}
+
* CHEBI:
−
{{#set: reconstruction category=orthology}}
+
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=50606 50606]
−
{{#set: reconstruction tool=pantograph}}
+
* BIGG : db4p
−
{{#set: reconstruction source=esiliculosus}}
+
* LIGAND-CPD:
 +
** [http://www.genome.jp/dbget-bin/www_bget?C15556 C15556]
 +
{{#set: smiles=CC(=O)C(O)COP(=O)([O-])[O-]}}
 +
{{#set: common name=1-deoxy-L-glycero-tetrulose 4-phosphate}}
 +
{{#set: inchi key=InChIKey=OKYHYXLCTGGOLM-SCSAIBSYSA-L}}
 +
{{#set: molecular weight=182.069    }}
 +
{{#set: common name=3,4-dihydroxy-2-butanone-4-phosphate|tetrolose phosphate|3,4-dihydroxy-2-butanone-4-P|L-3,4-dihydroxybutan-2-one-4-phosphate}}
 +
{{#set: produced by=DIOHBUTANONEPSYN-RXN}}

Latest revision as of 20:10, 21 March 2018

Metabolite DIHYDROXY-BUTANONE-P

  • smiles:
    • CC(=O)C(O)COP(=O)([O-])[O-]
  • common name:
    • 1-deoxy-L-glycero-tetrulose 4-phosphate
  • inchi key:
    • InChIKey=OKYHYXLCTGGOLM-SCSAIBSYSA-L
  • molecular weight:
    • 182.069
  • Synonym(s):
    • 3,4-dihydroxy-2-butanone-4-phosphate
    • tetrolose phosphate
    • 3,4-dihydroxy-2-butanone-4-P
    • L-3,4-dihydroxybutan-2-one-4-phosphate

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"CC(=O)C(O)COP(=O)([O-])[O-" cannot be used as a page name in this wiki.



Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=DIHYDROXY-BUTANONE-P&oldid=46522"