Difference between revisions of "Tiso gene 507"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-8990 CPD-8990] == * smiles: ** CS(=O)CCC([N+])C(=O)[O-] * inchi key: ** InChIKey=QEFRNWWLZK...")
(Created page with "Category:Gene == Gene Tiso_gene_507 == * Synonym(s): == Reactions associated == * Reaction: RXN-8036 ** Source: orthology-athaliana == Pathways associated == * ...")
 
(2 intermediate revisions by the same user not shown)
Line 1: Line 1:
[[Category:Metabolite]]
+
[[Category:Gene]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-8990 CPD-8990] ==
+
== Gene Tiso_gene_507 ==
* smiles:
+
** CS(=O)CCC([N+])C(=O)[O-]
+
* inchi key:
+
** InChIKey=QEFRNWWLZKMPFJ-ZXPFJRLXSA-N
+
* common name:
+
** L-methionine-(R)-S-oxide
+
* molecular weight:
+
** 165.207   
+
 
* Synonym(s):
 
* Synonym(s):
** L-methionine-R-sulfoxide
 
  
== Reaction(s) known to consume the compound ==
+
== Reactions associated ==
* [[1.8.4.14-RXN]]
+
* Reaction: [[RXN-8036]]
== Reaction(s) known to produce the compound ==
+
** Source: [[orthology-athaliana]]
== Reaction(s) of unknown directionality ==
+
== Pathways associated ==
 +
* [[PWY-5176]]
 
== External links  ==
 
== External links  ==
* PUBCHEM:
+
{{#set: reaction associated=RXN-8036}}
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=11862103 11862103]
+
{{#set: pathway associated=PWY-5176}}
* CHEBI:
+
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=58773 58773]
+
* BIGG : metsox_R__L
+
{{#set: smiles=CS(=O)CCC([N+])C(=O)[O-]}}
+
{{#set: inchi key=InChIKey=QEFRNWWLZKMPFJ-ZXPFJRLXSA-N}}
+
{{#set: common name=L-methionine-(R)-S-oxide}}
+
{{#set: molecular weight=165.207    }}
+
{{#set: common name=L-methionine-R-sulfoxide}}
+
{{#set: consumed by=1.8.4.14-RXN}}
+

Latest revision as of 20:10, 21 March 2018

Gene Tiso_gene_507

  • Synonym(s):

Reactions associated

Pathways associated

External links