Difference between revisions of "Tiso gene 4415"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-19167 CPD-19167] == * smiles: ** CCCCCCCCC=CCCCC(=O)CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=...")
(Created page with "Category:Gene == Gene Tiso_gene_4415 == * Synonym(s): == Reactions associated == * Reaction: AGMATIN-RXN ** Source: orthology-esiliculosus * Reaction: ARGINASE-...")
 
(2 intermediate revisions by the same user not shown)
Line 1: Line 1:
[[Category:Metabolite]]
+
[[Category:Gene]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-19167 CPD-19167] ==
+
== Gene Tiso_gene_4415 ==
* smiles:
+
** CCCCCCCCC=CCCCC(=O)CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]
+
* inchi key:
+
** InChIKey=BUCIFQOXNYHEOO-YDGGZUKGSA-J
+
* common name:
+
** 3-oxo-(7Z)-hexadecenoyl-CoA
+
* molecular weight:
+
** 1013.883   
+
 
* Synonym(s):
 
* Synonym(s):
** 3-oxo-16:1-Δ7-CoA
 
** 3-oxo-7-cis-hexadecenoyl-CoA
 
  
== Reaction(s) known to consume the compound ==
+
== Reactions associated ==
* [[RXN-17782]]
+
* Reaction: [[AGMATIN-RXN]]
== Reaction(s) known to produce the compound ==
+
** Source: [[orthology-esiliculosus]]
* [[RXN-17781]]
+
* Reaction: [[ARGINASE-RXN]]
== Reaction(s) of unknown directionality ==
+
** Source: [[orthology-athaliana]]
 +
** Source: [[orthology-esiliculosus]]
 +
* Reaction: [[GUANIDINOBUTYRASE-RXN]]
 +
** Source: [[orthology-synechocystis]]
 +
== Pathways associated ==
 +
* [[ARGASEDEG-PWY]]
 +
* [[PWY0-823]]
 +
* [[ARGDEG-IV-PWY]]
 +
* [[ARG-PRO-PWY]]
 +
* [[ARG-GLU-PWY]]
 +
* [[ARGDEG-V-PWY]]
 +
* [[PWY-4984]]
 +
* [[PWY-5742]]
 +
* [[PWY-7523]]
 +
* [[PWY-6305]]
 +
* [[PWY-6922]]
 +
* [[PWY-40]]
 +
* [[CITRULBIO-PWY]]
 
== External links  ==
 
== External links  ==
{{#set: smiles=CCCCCCCCC=CCCCC(=O)CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]}}
+
{{#set: reaction associated=AGMATIN-RXN|ARGINASE-RXN|GUANIDINOBUTYRASE-RXN}}
{{#set: inchi key=InChIKey=BUCIFQOXNYHEOO-YDGGZUKGSA-J}}
+
{{#set: pathway associated=ARGASEDEG-PWY|PWY0-823|ARGDEG-IV-PWY|ARG-PRO-PWY|ARG-GLU-PWY|ARGDEG-V-PWY|PWY-4984|PWY-5742|PWY-7523|PWY-6305|PWY-6922|PWY-40|CITRULBIO-PWY}}
{{#set: common name=3-oxo-(7Z)-hexadecenoyl-CoA}}
+
{{#set: molecular weight=1013.883    }}
+
{{#set: common name=3-oxo-16:1-Δ7-CoA|3-oxo-7-cis-hexadecenoyl-CoA}}
+
{{#set: consumed by=RXN-17782}}
+
{{#set: produced by=RXN-17781}}
+

Latest revision as of 20:10, 21 March 2018

Gene Tiso_gene_4415

  • Synonym(s):

Reactions associated

Pathways associated

External links