Difference between revisions of "RXN-16615"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=SINAPATE SINAPATE] == * smiles: ** COC1(C=C(C=C(OC)C(O)=1)C=CC([O-])=O) * inchi key: ** InChIKe...") |
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-16615 RXN-16615] == * direction: ** LEFT-TO-RIGHT * common name: ** 3-oxoacyl-synthase * ec num...") |
||
(2 intermediate revisions by the same user not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Reaction]] |
− | == | + | == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-16615 RXN-16615] == |
− | * | + | * direction: |
− | ** | + | ** LEFT-TO-RIGHT |
− | + | ||
− | + | ||
* common name: | * common name: | ||
− | ** | + | ** 3-oxoacyl-synthase |
− | * | + | * ec number: |
− | ** | + | ** [http://enzyme.expasy.org/EC/2.3.1.41 EC-2.3.1.41] |
* Synonym(s): | * Synonym(s): | ||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | == Reaction | + | == Reaction Formula == |
− | * [[ | + | * With identifiers: |
− | = | + | ** 1 [[MALONYL-ACP]][c] '''+''' 1 [[3Z-dodec-3-enoyl-ACPs]][c] '''+''' 1 [[PROTON]][c] '''=>''' 1 [[ACP]][c] '''+''' 1 [[CARBON-DIOXIDE]][c] '''+''' 1 [[5Z-3-oxo-tetradec-5-enoyl-ACPs]][c] |
− | * [[ | + | * With common name(s): |
− | * [[ | + | ** 1 a malonyl-[acp][c] '''+''' 1 a (3Z)-dodec-3-enoyl-[acp][c] '''+''' 1 H+[c] '''=>''' 1 a holo-[acyl-carrier protein][c] '''+''' 1 CO2[c] '''+''' 1 a (5Z)-3-oxo-tetradec-5-enoyl-[acp][c] |
− | == | + | |
+ | == Genes associated with this reaction == | ||
+ | Genes have been associated with this reaction based on different elements listed below. | ||
+ | * Gene: [[Tiso_gene_5939]] | ||
+ | ** Source: [[annotation-in-silico_annotation]] | ||
+ | *** Assignment: EC-NUMBER | ||
+ | ** Source: [[annotation-experimental_annotation]] | ||
+ | *** Assignment: EC-NUMBER | ||
+ | == Pathways == | ||
+ | * [[PWY-7664]], oleate biosynthesis IV (anaerobic): [http://metacyc.org/META/NEW-IMAGE?object=PWY-7664 PWY-7664] | ||
+ | ** '''10''' reactions found over '''14''' reactions in the full pathway | ||
+ | == Reconstruction information == | ||
+ | * Category: [[annotation]] | ||
+ | ** Source: [[annotation-in-silico_annotation]] | ||
+ | *** Tool: [[pathwaytools]] | ||
+ | ** Source: [[annotation-experimental_annotation]] | ||
+ | *** Tool: [[pathwaytools]] | ||
== External links == | == External links == | ||
− | + | {{#set: direction=LEFT-TO-RIGHT}} | |
− | + | {{#set: common name=3-oxoacyl-synthase}} | |
− | + | {{#set: ec number=EC-2.3.1.41}} | |
− | + | {{#set: gene associated=Tiso_gene_5939}} | |
− | + | {{#set: in pathway=PWY-7664}} | |
− | + | {{#set: reconstruction category=annotation}} | |
− | + | {{#set: reconstruction source=annotation-in-silico_annotation|annotation-experimental_annotation}} | |
− | + | {{#set: reconstruction tool=pathwaytools}} | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + |
Latest revision as of 20:10, 21 March 2018
Contents
Reaction RXN-16615
- direction:
- LEFT-TO-RIGHT
- common name:
- 3-oxoacyl-synthase
- ec number:
- Synonym(s):
Reaction Formula
- With identifiers:
- 1 MALONYL-ACP[c] + 1 3Z-dodec-3-enoyl-ACPs[c] + 1 PROTON[c] => 1 ACP[c] + 1 CARBON-DIOXIDE[c] + 1 5Z-3-oxo-tetradec-5-enoyl-ACPs[c]
- With common name(s):
- 1 a malonyl-[acp][c] + 1 a (3Z)-dodec-3-enoyl-[acp][c] + 1 H+[c] => 1 a holo-[acyl-carrier protein][c] + 1 CO2[c] + 1 a (5Z)-3-oxo-tetradec-5-enoyl-[acp][c]
Genes associated with this reaction
Genes have been associated with this reaction based on different elements listed below.
- Gene: Tiso_gene_5939
- Source: annotation-in-silico_annotation
- Assignment: EC-NUMBER
- Source: annotation-experimental_annotation
- Assignment: EC-NUMBER
- Source: annotation-in-silico_annotation
Pathways
- PWY-7664, oleate biosynthesis IV (anaerobic): PWY-7664
- 10 reactions found over 14 reactions in the full pathway
Reconstruction information
- Category: annotation
- Source: annotation-in-silico_annotation
- Tool: pathwaytools
- Source: annotation-experimental_annotation
- Tool: pathwaytools
- Source: annotation-in-silico_annotation