Difference between revisions of "Tiso gene 17314"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=ALPHA-GLC-6-P ALPHA-GLC-6-P] == * smiles: ** C(OP(=O)([O-])[O-])C1(OC(O)C(O)C(O)C(O)1) * inchi...")
(Created page with "Category:Gene == Gene Tiso_gene_17314 == * right end position: ** 3672 * transcription direction: ** NEGATIVE * left end position: ** 846 * centisome position: ** 22.31601...")
 
(2 intermediate revisions by the same user not shown)
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Gene]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=ALPHA-GLC-6-P ALPHA-GLC-6-P] ==
+
== Gene Tiso_gene_17314 ==
−
* smiles:
+
* right end position:
−
** C(OP(=O)([O-])[O-])C1(OC(O)C(O)C(O)C(O)1)
+
** 3672
−
* inchi key:
+
* transcription direction:
−
** InChIKey=NBSCHQHZLSJFNQ-DVKNGEFBSA-L
+
** NEGATIVE
−
* common name:
+
* left end position:
−
** α-D-glucose 6-phosphate
+
** 846
−
* molecular weight:
+
* centisome position:
−
** 258.121    
+
** 22.316011    
 
* Synonym(s):
 
* Synonym(s):
−
** α-glucose 6-phosphate
 
−
** α-D-glucose-6-P
 
  
−
== Reaction(s) known to consume the compound ==
+
== Reactions associated ==
−
* [[UG6PGT]]
+
* Reaction: [[3.1.3.16-RXN]]
−
* [[UG6PGTn]]
+
** Source: [[annotation-experimental_annotation]]
−
* [[G6PADHh]]
+
*** Assignment: automated-name-match
−
== Reaction(s) known to produce the compound ==
+
== Pathways associated ==
−
* [[BFFS]]
+
−
* [[RXN-1685]]
+
−
== Reaction(s) of unknown directionality ==
+
−
* [[PGIA]]
+
−
* [[PGIAh]]
+
−
* [[G6PI]]
+
−
* [[G6PA_pi_th]]
+
−
* [[RXN-6182]]
+
−
* [[GLUCOSE-6-PHOSPHATE-1-EPIMERASE-RXN]]
+
−
* [[PGMTh]]
+
−
* [[PGCM]]
+
 
== External links  ==
 
== External links  ==
−
* PUBCHEM:
+
{{#set: right end position=3672}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=21604864 21604864]
+
{{#set: transcription direction=NEGATIVE}}
−
* CHEMSPIDER:
+
{{#set: left end position=846}}
−
** [http://www.chemspider.com/Chemical-Structure.10239175.html 10239175]
+
{{#set: centisome position=22.316011   }}
−
* CHEBI:
+
{{#set: reaction associated=3.1.3.16-RXN}}
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=58225 58225]
+
−
* LIGAND-CPD:
+
−
** [http://www.genome.jp/dbget-bin/www_bget?C00668 C00668]
+
−
{{#set: smiles=C(OP(=O)([O-])[O-])C1(OC(O)C(O)C(O)C(O)1)}}
+
−
{{#set: inchi key=InChIKey=NBSCHQHZLSJFNQ-DVKNGEFBSA-L}}
+
−
{{#set: common name=α-D-glucose 6-phosphate}}
+
−
{{#set: molecular weight=258.121   }}
+
−
{{#set: common name=α-glucose 6-phosphate|α-D-glucose-6-P}}
+
−
{{#set: consumed by=UG6PGT|UG6PGTn|G6PADHh}}
+
−
{{#set: produced by=BFFS|RXN-1685}}
+
−
{{#set: consumed or produced by=PGIA|PGIAh|G6PI|G6PA_pi_th|RXN-6182|GLUCOSE-6-PHOSPHATE-1-EPIMERASE-RXN|PGMTh|PGCM}}
+

Latest revision as of 20:10, 21 March 2018

Gene Tiso_gene_17314

  • right end position:
    • 3672
  • transcription direction:
    • NEGATIVE
  • left end position:
    • 846
  • centisome position:
    • 22.316011
  • Synonym(s):

Reactions associated

Pathways associated

External links

Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=Tiso_gene_17314&oldid=46568"