Difference between revisions of "Tiso gene 12997"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=PARAOXON PARAOXON] == * smiles: ** CCOP(OC1(C=CC(=CC=1)[N+]([O-])=O))(OCC)=O * inchi key: ** In...")
(Created page with "Category:Gene == Gene Tiso_gene_12997 == * right end position: ** 11370 * transcription direction: ** NEGATIVE * left end position: ** 9062 * centisome position: ** 78.296...")
 
(2 intermediate revisions by the same user not shown)
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Gene]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=PARAOXON PARAOXON] ==
+
== Gene Tiso_gene_12997 ==
−
* smiles:
+
* right end position:
−
** CCOP(OC1(C=CC(=CC=1)[N+]([O-])=O))(OCC)=O
+
** 11370
−
* inchi key:
+
* transcription direction:
−
** InChIKey=WYMSBXTXOHUIGT-UHFFFAOYSA-N
+
** NEGATIVE
−
* common name:
+
* left end position:
−
** paraoxon
+
** 9062
−
* molecular weight:
+
* centisome position:
−
** 275.197    
+
** 78.29618    
 
* Synonym(s):
 
* Synonym(s):
−
** O,O-diethyl-O-p-nitrophenylphosphoric acid
 
−
** diethyl-p-nitrophenyl phosphate
 
−
** phosphoric acid diethyl 4-nitrophenyl ester
 
−
** diethyl paraoxon
 
  
−
== Reaction(s) known to consume the compound ==
+
== Reactions associated ==
−
* [[RXN-8746]]
+
* Reaction: [[ARGININE--TRNA-LIGASE-RXN]]
−
== Reaction(s) known to produce the compound ==
+
** Source: [[annotation-in-silico_annotation]]
−
== Reaction(s) of unknown directionality ==
+
*** Assignment: ec-number
 +
** Source: [[annotation-experimental_annotation]]
 +
*** Assignment: ec-number
 +
** Source: [[orthology-esiliculosus]]
 +
== Pathways associated ==
 +
* [[TRNA-CHARGING-PWY]]
 
== External links  ==
 
== External links  ==
−
* CAS : 311-45-5
+
{{#set: right end position=11370}}
−
* PUBCHEM:
+
{{#set: transcription direction=NEGATIVE}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=9395 9395]
+
{{#set: left end position=9062}}
−
* HMDB : HMDB13035
+
{{#set: centisome position=78.29618   }}
−
* LIGAND-CPD:
+
{{#set: reaction associated=ARGININE--TRNA-LIGASE-RXN}}
−
** [http://www.genome.jp/dbget-bin/www_bget?C06606 C06606]
+
{{#set: pathway associated=TRNA-CHARGING-PWY}}
−
* CHEMSPIDER:
+
−
** [http://www.chemspider.com/Chemical-Structure.9026.html 9026]
+
−
* CHEBI:
+
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=27827 27827]
+
−
{{#set: smiles=CCOP(OC1(C=CC(=CC=1)[N+]([O-])=O))(OCC)=O}}
+
−
{{#set: inchi key=InChIKey=WYMSBXTXOHUIGT-UHFFFAOYSA-N}}
+
−
{{#set: common name=paraoxon}}
+
−
{{#set: molecular weight=275.197   }}
+
−
{{#set: common name=O,O-diethyl-O-p-nitrophenylphosphoric acid|diethyl-p-nitrophenyl phosphate|phosphoric acid diethyl 4-nitrophenyl ester|diethyl paraoxon}}
+
−
{{#set: consumed by=RXN-8746}}
+

Latest revision as of 20:11, 21 March 2018

Gene Tiso_gene_12997

  • right end position:
    • 11370
  • transcription direction:
    • NEGATIVE
  • left end position:
    • 9062
  • centisome position:
    • 78.29618
  • Synonym(s):

Reactions associated

Pathways associated

External links

Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=Tiso_gene_12997&oldid=46643"