Difference between revisions of "CPD-6224"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-7663 RXN-7663] == * direction: ** LEFT-TO-RIGHT * common name: ** chlorophyll_chloroplastic * e...")
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-6224 CPD-6224] == * smiles: ** C=C1(C3(CC4(C1)(C([CH]5(C2(C(=O)OC(CC(O)C(O)2)([CH](CC3)4)5)...")
 
(2 intermediate revisions by the same user not shown)
Line 1: Line 1:
−
[[Category:Reaction]]
+
[[Category:Metabolite]]
−
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-7663 RXN-7663] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-6224 CPD-6224] ==
−
* direction:
+
* smiles:
−
** LEFT-TO-RIGHT
+
** C=C1(C3(CC4(C1)(C([CH]5(C2(C(=O)OC(CC(O)C(O)2)([CH](CC3)4)5)(C)))C([O-])=O)))
 
* common name:
 
* common name:
−
** chlorophyll_chloroplastic
+
** gibberellin A34
−
* ec number:
+
* inchi key:
−
** [http://enzyme.expasy.org/EC/2.5.1.62 EC-2.5.1.62]
+
** InChIKey=IGZIQAJJXGRAJF-OQAXFVLUSA-M
 +
* molecular weight:
 +
** 347.387   
 
* Synonym(s):
 
* Synonym(s):
 +
** GA34
  
−
== Reaction Formula ==
+
== Reaction(s) known to consume the compound ==
−
* With identifiers:
+
== Reaction(s) known to produce the compound ==
−
** 1 [[PROTON]][c] '''+''' 1 [[CHLOROPHYLLIDE-A]][c] '''+''' 1 [[GERANYLGERANYL-PP]][c] '''=>''' 1 [[PPI]][c] '''+''' 1 [[CPD-7005]][c]
+
* [[RXN-6550]]
−
* With common name(s):
+
== Reaction(s) of unknown directionality ==
−
** 1 H+[c] '''+''' 1 chlorophyllide a[c] '''+''' 1 geranylgeranyl diphosphate[c] '''=>''' 1 diphosphate[c] '''+''' 1 geranylgeranyl chlorophyll a[c]
+
−
 
+
−
== Genes associated with this reaction  ==
+
−
Genes have been associated with this reaction based on different elements listed below.
+
−
* [[Tiso_gene_19542]]
+
−
** IN-SILICO_ANNOTATION
+
−
***EC-NUMBER
+
−
** [[pantograph]]-[[creinhardtii]]
+
−
== Pathways  ==
+
−
* [[PWY-5064]], chlorophyll a biosynthesis II: [http://metacyc.org/META/NEW-IMAGE?object=PWY-5064 PWY-5064]
+
−
** '''5''' reactions found over '''5''' reactions in the full pathway
+
−
== Reconstruction information  ==
+
−
* [[orthology]]:
+
−
** [[pantograph]]:
+
−
*** [[creinhardtii]]
+
−
* [[manual]]:
+
−
** [[primary_network]]
+
−
* [[annotation]]:
+
−
** [[pathwaytools]]:
+
−
*** [[in-silico_annotation]]
+
 
== External links  ==
 
== External links  ==
−
{{#set: direction=LEFT-TO-RIGHT}}
+
* LIPID_MAPS : LMPR0104170025
−
{{#set: common name=chlorophyll_chloroplastic}}
+
* PUBCHEM:
−
{{#set: ec number=EC-2.5.1.62}}
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25245079 25245079]
−
{{#set: gene associated=Tiso_gene_19542}}
+
* CHEBI:
−
{{#set: in pathway=PWY-5064}}
+
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=29593 29593]
−
{{#set: reconstruction category=orthology}}
+
* LIGAND-CPD:
−
{{#set: reconstruction tool=pantograph}}
+
** [http://www.genome.jp/dbget-bin/www_bget?C11868 C11868]
−
{{#set: reconstruction source=creinhardtii}}
+
{{#set: smiles=C=C1(C3(CC4(C1)(C([CH]5(C2(C(=O)OC(CC(O)C(O)2)([CH](CC3)4)5)(C)))C([O-])=O)))}}
−
{{#set: reconstruction category=manual}}
+
{{#set: common name=gibberellin A34}}
−
{{#set: reconstruction source=primary_network}}
+
{{#set: inchi key=InChIKey=IGZIQAJJXGRAJF-OQAXFVLUSA-M}}
−
{{#set: reconstruction category=annotation}}
+
{{#set: molecular weight=347.387    }}
−
{{#set: reconstruction tool=pathwaytools}}
+
{{#set: common name=GA34}}
−
{{#set: reconstruction source=in-silico_annotation}}
+
{{#set: produced by=RXN-6550}}

Latest revision as of 20:11, 21 March 2018

Metabolite CPD-6224

  • smiles:
    • C=C1(C3(CC4(C1)(C([CH]5(C2(C(=O)OC(CC(O)C(O)2)([CH](CC3)4)5)(C)))C([O-])=O)))
  • common name:
    • gibberellin A34
  • inchi key:
    • InChIKey=IGZIQAJJXGRAJF-OQAXFVLUSA-M
  • molecular weight:
    • 347.387
  • Synonym(s):
    • GA34

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"C=C1(C3(CC4(C1)(C([CH]5(C2(C(=O)OC(CC(O)C(O)2)([CH](CC3)4)5)(C)))C([O-])=O)))" cannot be used as a page name in this wiki.



Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=CPD-6224&oldid=46647"