Difference between revisions of "CPD-11641"
From metabolic_network
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-8315 RXN-8315] == * direction: ** REVERSIBLE * Synonym(s): == Reaction Formula == * With ident...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-11641 CPD-11641] == * smiles: ** CC3(C2(C=CC(OC1(OC(CO)C(O)C(O)C(O)1))=CC=2OC(=O)C=3)) * co...") |
||
| (2 intermediate revisions by the same user not shown) | |||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:Metabolite]] |
| − | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-11641 CPD-11641] == |
| − | * | + | * smiles: |
| − | ** | + | ** CC3(C2(C=CC(OC1(OC(CO)C(O)C(O)C(O)1))=CC=2OC(=O)C=3)) |
| + | * common name: | ||
| + | ** 4-methylumbelliferyl glucoside | ||
| + | * inchi key: | ||
| + | ** InChIKey=YUDPTGPSBJVHCN-YMILTQATSA-N | ||
| + | * molecular weight: | ||
| + | ** 338.313 | ||
* Synonym(s): | * Synonym(s): | ||
| + | ** 4-MU-glucoside | ||
| − | == Reaction | + | == Reaction(s) known to consume the compound == |
| − | * | + | * [[RXN-10769]] |
| − | + | == Reaction(s) known to produce the compound == | |
| − | + | == Reaction(s) of unknown directionality == | |
| − | + | ||
| − | + | ||
| − | + | ||
| − | == | + | |
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
== External links == | == External links == | ||
| − | {{#set: | + | * DRUGBANK : DB02639 |
| − | {{#set: | + | * PUBCHEM: |
| − | {{#set: | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=2733779 2733779] |
| − | {{#set: | + | * CHEMSPIDER: |
| − | {{#set: | + | ** [http://www.chemspider.com/Chemical-Structure.2015550.html 2015550] |
| + | * CHEBI: | ||
| + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=91117 91117] | ||
| + | {{#set: smiles=CC3(C2(C=CC(OC1(OC(CO)C(O)C(O)C(O)1))=CC=2OC(=O)C=3))}} | ||
| + | {{#set: common name=4-methylumbelliferyl glucoside}} | ||
| + | {{#set: inchi key=InChIKey=YUDPTGPSBJVHCN-YMILTQATSA-N}} | ||
| + | {{#set: molecular weight=338.313 }} | ||
| + | {{#set: common name=4-MU-glucoside}} | ||
| + | {{#set: consumed by=RXN-10769}} | ||
Latest revision as of 20:11, 21 March 2018
Contents
Metabolite CPD-11641
- smiles:
- CC3(C2(C=CC(OC1(OC(CO)C(O)C(O)C(O)1))=CC=2OC(=O)C=3))
- common name:
- 4-methylumbelliferyl glucoside
- inchi key:
- InChIKey=YUDPTGPSBJVHCN-YMILTQATSA-N
- molecular weight:
- 338.313
- Synonym(s):
- 4-MU-glucoside
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
