Difference between revisions of "Tiso gene 12375"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-6224 CPD-6224] == * smiles: ** C=C1(C3(CC4(C1)(C([CH]5(C2(C(=O)OC(CC(O)C(O)2)([CH](CC3)4)5)...")
(Created page with "Category:Gene == Gene Tiso_gene_12375 == * right end position: ** 7021 * transcription direction: ** NEGATIVE * left end position: ** 1881 * centisome position: ** 26.5004...")
 
(2 intermediate revisions by the same user not shown)
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Gene]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-6224 CPD-6224] ==
+
== Gene Tiso_gene_12375 ==
−
* smiles:
+
* right end position:
−
** C=C1(C3(CC4(C1)(C([CH]5(C2(C(=O)OC(CC(O)C(O)2)([CH](CC3)4)5)(C)))C([O-])=O)))
+
** 7021
−
* inchi key:
+
* transcription direction:
−
** InChIKey=IGZIQAJJXGRAJF-OQAXFVLUSA-M
+
** NEGATIVE
−
* common name:
+
* left end position:
−
** gibberellin A34
+
** 1881
−
* molecular weight:
+
* centisome position:
−
** 347.387    
+
** 26.500422    
 
* Synonym(s):
 
* Synonym(s):
−
** GA34
 
  
−
== Reaction(s) known to consume the compound ==
+
== Reactions associated ==
−
== Reaction(s) known to produce the compound ==
+
* Reaction: [[3.1.1.23-RXN]]
−
* [[RXN-6550]]
+
** Source: [[annotation-in-silico_annotation]]
−
== Reaction(s) of unknown directionality ==
+
*** Assignment: ec-number
 +
* Reaction: [[LYSOPHOSPHOLIPASE-RXN]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Assignment: ec-number
 +
* Reaction: [[RXN-15035]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Assignment: ec-number
 +
* Reaction: [[RXN-15088]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Assignment: ec-number
 +
* Reaction: [[RXN-15089]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Assignment: ec-number
 +
== Pathways associated ==
 +
* [[PWY-7409]]
 +
* [[LIPAS-PWY]]
 +
* [[PWY-7420]]
 
== External links  ==
 
== External links  ==
−
* LIPID_MAPS : LMPR0104170025
+
{{#set: right end position=7021}}
−
* PUBCHEM:
+
{{#set: transcription direction=NEGATIVE}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25245079 25245079]
+
{{#set: left end position=1881}}
−
* CHEBI:
+
{{#set: centisome position=26.500422   }}
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=29593 29593]
+
{{#set: reaction associated=3.1.1.23-RXN|LYSOPHOSPHOLIPASE-RXN|RXN-15035|RXN-15088|RXN-15089}}
−
* LIGAND-CPD:
+
{{#set: pathway associated=PWY-7409|LIPAS-PWY|PWY-7420}}
−
** [http://www.genome.jp/dbget-bin/www_bget?C11868 C11868]
+
−
{{#set: smiles=C=C1(C3(CC4(C1)(C([CH]5(C2(C(=O)OC(CC(O)C(O)2)([CH](CC3)4)5)(C)))C([O-])=O)))}}
+
−
{{#set: inchi key=InChIKey=IGZIQAJJXGRAJF-OQAXFVLUSA-M}}
+
−
{{#set: common name=gibberellin A34}}
+
−
{{#set: molecular weight=347.387   }}
+
−
{{#set: common name=GA34}}
+
−
{{#set: produced by=RXN-6550}}
+

Latest revision as of 20:11, 21 March 2018

Gene Tiso_gene_12375

  • right end position:
    • 7021
  • transcription direction:
    • NEGATIVE
  • left end position:
    • 1881
  • centisome position:
    • 26.500422
  • Synonym(s):

Reactions associated

Pathways associated

External links

Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=Tiso_gene_12375&oldid=46698"