Difference between revisions of "ALCDH nadp i"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-6972 CPD-6972] == * smiles: ** CC(COP([O-])(=O)OP([O-])(=O)OCC3(C(C(C(N2(C=NC1(C(=NC=NC=12)...")
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=ALCDH_nadp_i ALCDH_nadp_i] == * direction: ** LEFT-TO-RIGHT * common name: ** alcohol dehydrogenase...")
 
(2 intermediate revisions by the same user not shown)
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Reaction]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-6972 CPD-6972] ==
+
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=ALCDH_nadp_i ALCDH_nadp_i] ==
−
* smiles:
+
* direction:
−
** CC(COP([O-])(=O)OP([O-])(=O)OCC3(C(C(C(N2(C=NC1(C(=NC=NC=12)N)))O3)O)OP([O-])(=O)[O-]))(C)C(C(NCCC(NCCSC(CCC(C4(C=CC=CC(C([O-])=O)=4))=O)=O)=O)=O)O
+
** LEFT-TO-RIGHT
−
* inchi key:
+
−
** InChIKey=KVAQAPQXOXTRAE-UHFFFAOYSA-I
+
 
* common name:
 
* common name:
−
** 4-(2'-carboxyphenyl)-4-oxobutyryl-CoA
+
** alcohol dehydrogenase (ethanol, NADP)
−
* molecular weight:
+
−
** 966.676   
+
 
* Synonym(s):
 
* Synonym(s):
−
** succinylbenzoyl-CoA
 
−
** 2-succinylbenzoyl-CoA
 
−
** 2-(3'-carboxypropionyl)benzoyl-CoA
 
−
** o-succinylbenzoyl-CoA
 
  
−
== Reaction(s) known to consume the compound ==
+
== Reaction Formula ==
−
* [[NAPHTHOATE-SYN-RXN]]
+
* With identifiers:
−
== Reaction(s) known to produce the compound ==
+
** 1.0 [[ACETALD]][c] '''+''' 1.0 [[PROTON]][c] '''+''' 1.0 [[NADPH]][c] '''=>''' 1.0 [[ETOH]][c] '''+''' 1.0 [[NADP]][c]
−
== Reaction(s) of unknown directionality ==
+
* With common name(s):
 +
** 1.0 acetaldehyde[c] '''+''' 1.0 H+[c] '''+''' 1.0 NADPH[c] '''=>''' 1.0 ethanol[c] '''+''' 1.0 NADP+[c]
 +
 
 +
== Genes associated with this reaction  ==
 +
Genes have been associated with this reaction based on different elements listed below.
 +
* Gene: [[Tiso_gene_14126]]
 +
** Source: [[orthology-creinhardtii]]
 +
== Pathways  ==
 +
== Reconstruction information  ==
 +
* Category: [[orthology]]
 +
** Source: [[orthology-creinhardtii]]
 +
*** Tool: [[pantograph]]
 
== External links  ==
 
== External links  ==
−
* PUBCHEM:
+
{{#set: direction=LEFT-TO-RIGHT}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25245100 25245100]
+
{{#set: common name=alcohol dehydrogenase (ethanol, NADP)}}
−
* CHEBI:
+
{{#set: gene associated=Tiso_gene_14126}}
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=15509 15509]
+
{{#set: in pathway=}}
−
* BIGG : sbzcoa
+
{{#set: reconstruction category=orthology}}
−
* LIGAND-CPD:
+
{{#set: reconstruction source=orthology-creinhardtii}}
−
** [http://www.genome.jp/dbget-bin/www_bget?C03160 C03160]
+
{{#set: reconstruction tool=pantograph}}
−
{{#set: smiles=CC(COP([O-])(=O)OP([O-])(=O)OCC3(C(C(C(N2(C=NC1(C(=NC=NC=12)N)))O3)O)OP([O-])(=O)[O-]))(C)C(C(NCCC(NCCSC(CCC(C4(C=CC=CC(C([O-])=O)=4))=O)=O)=O)=O)O}}
+
−
{{#set: inchi key=InChIKey=KVAQAPQXOXTRAE-UHFFFAOYSA-I}}
+
−
{{#set: common name=4-(2'-carboxyphenyl)-4-oxobutyryl-CoA}}
+
−
{{#set: molecular weight=966.676    }}
+
−
{{#set: common name=succinylbenzoyl-CoA|2-succinylbenzoyl-CoA|2-(3'-carboxypropionyl)benzoyl-CoA|o-succinylbenzoyl-CoA}}
+
−
{{#set: consumed by=NAPHTHOATE-SYN-RXN}}
+

Latest revision as of 20:11, 21 March 2018

Reaction ALCDH_nadp_i

  • direction:
    • LEFT-TO-RIGHT
  • common name:
    • alcohol dehydrogenase (ethanol, NADP)
  • Synonym(s):

Reaction Formula

  • With identifiers:
  • With common name(s):
    • 1.0 acetaldehyde[c] + 1.0 H+[c] + 1.0 NADPH[c] => 1.0 ethanol[c] + 1.0 NADP+[c]

Genes associated with this reaction

Genes have been associated with this reaction based on different elements listed below.

Pathways

Reconstruction information

External links

Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=ALCDH_nadp_i&oldid=46724"