Difference between revisions of "Tiso gene 3392"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-725 CPD-725] == * smiles: ** CCC=CCC(C=CC=CCCCCCCCC([O-])=O)OO * inchi key: ** InChIKey=UYQ...") |
(Created page with "Category:Gene == Gene Tiso_gene_3392 == * right end position: ** 16725 * transcription direction: ** POSITIVE * left end position: ** 14616 * centisome position: ** 86.746...") |
||
(2 intermediate revisions by the same user not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Gene]] |
− | == | + | == Gene Tiso_gene_3392 == |
− | * | + | * right end position: |
− | ** | + | ** 16725 |
− | * | + | * transcription direction: |
− | ** | + | ** POSITIVE |
− | * | + | * left end position: |
− | ** | + | ** 14616 |
− | * | + | * centisome position: |
− | ** | + | ** 86.746994 |
* Synonym(s): | * Synonym(s): | ||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | == | + | == Reactions associated == |
− | + | * Reaction: [[3.2.1.47-RXN]] | |
− | * [[RXN- | + | ** Source: [[orthology-athaliana]] |
− | == | + | * Reaction: [[ALPHAGALACTOSID-RXN]] |
+ | ** Source: [[annotation-in-silico_annotation]] | ||
+ | *** Assignment: automated-name-match | ||
+ | ** Source: [[orthology-athaliana]] | ||
+ | * Reaction: [[RXN-11501]] | ||
+ | ** Source: [[annotation-in-silico_annotation]] | ||
+ | *** Assignment: automated-name-match | ||
+ | ** Source: [[orthology-athaliana]] | ||
+ | * Reaction: [[RXN-11502]] | ||
+ | ** Source: [[annotation-in-silico_annotation]] | ||
+ | *** Assignment: automated-name-match | ||
+ | ** Source: [[orthology-athaliana]] | ||
+ | * Reaction: [[RXN-12088]] | ||
+ | ** Source: [[annotation-in-silico_annotation]] | ||
+ | *** Assignment: automated-name-match | ||
+ | * Reaction: [[RXN-17754]] | ||
+ | ** Source: [[annotation-in-silico_annotation]] | ||
+ | *** Assignment: automated-name-match | ||
+ | * Reaction: [[RXN-17830]] | ||
+ | ** Source: [[annotation-in-silico_annotation]] | ||
+ | *** Assignment: automated-name-match | ||
+ | == Pathways associated == | ||
+ | * [[PWY-6527]] | ||
+ | * [[PWY0-1301]] | ||
== External links == | == External links == | ||
− | + | {{#set: right end position=16725}} | |
− | + | {{#set: transcription direction=POSITIVE}} | |
− | + | {{#set: left end position=14616}} | |
− | + | {{#set: centisome position=86.746994 }} | |
− | + | {{#set: reaction associated=3.2.1.47-RXN|ALPHAGALACTOSID-RXN|RXN-11501|RXN-11502|RXN-12088|RXN-17754|RXN-17830}} | |
− | + | {{#set: pathway associated=PWY-6527|PWY0-1301}} | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + |
Latest revision as of 20:12, 21 March 2018
Gene Tiso_gene_3392
- right end position:
- 16725
- transcription direction:
- POSITIVE
- left end position:
- 14616
- centisome position:
- 86.746994
- Synonym(s):
Reactions associated
- Reaction: 3.2.1.47-RXN
- Source: orthology-athaliana
- Reaction: ALPHAGALACTOSID-RXN
- Source: annotation-in-silico_annotation
- Assignment: automated-name-match
- Source: orthology-athaliana
- Source: annotation-in-silico_annotation
- Reaction: RXN-11501
- Source: annotation-in-silico_annotation
- Assignment: automated-name-match
- Source: orthology-athaliana
- Source: annotation-in-silico_annotation
- Reaction: RXN-11502
- Source: annotation-in-silico_annotation
- Assignment: automated-name-match
- Source: orthology-athaliana
- Source: annotation-in-silico_annotation
- Reaction: RXN-12088
- Source: annotation-in-silico_annotation
- Assignment: automated-name-match
- Source: annotation-in-silico_annotation
- Reaction: RXN-17754
- Source: annotation-in-silico_annotation
- Assignment: automated-name-match
- Source: annotation-in-silico_annotation
- Reaction: RXN-17830
- Source: annotation-in-silico_annotation
- Assignment: automated-name-match
- Source: annotation-in-silico_annotation