Difference between revisions of "CPD-16551"
From metabolic_network
(Created page with "Category:Gene == Gene Tiso_gene_17614 == * left end position: ** 1694 * transcription direction: ** POSITIVE * right end position: ** 3326 * centisome position: ** 47.3846...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-16551 CPD-16551] == * smiles: ** C(OP([O-])(=O)[O-])C1(C(O)C(O)C(O)O1) * common name: ** &b...") |
||
| (2 intermediate revisions by the same user not shown) | |||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:Metabolite]] |
| − | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-16551 CPD-16551] == |
| − | * | + | * smiles: |
| − | ** | + | ** C(OP([O-])(=O)[O-])C1(C(O)C(O)C(O)O1) |
| − | * | + | * common name: |
| − | ** | + | ** β-D-ribose 5-phosphate |
| − | * | + | * inchi key: |
| − | ** | + | ** InChIKey=KTVPXOYAKDPRHY-TXICZTDVSA-L |
| − | * | + | * molecular weight: |
| − | ** | + | ** 228.095 |
* Synonym(s): | * Synonym(s): | ||
| + | ** β-D-ribofuranose 5-phosphate | ||
| + | ** 5-O-phosphono-β-D-ribofuranose | ||
| − | == | + | == Reaction(s) known to consume the compound == |
| − | * [[RXN- | + | * [[RXN-15346]] |
| − | + | == Reaction(s) known to produce the compound == | |
| − | + | * [[RXN-15345]] | |
| − | + | == Reaction(s) of unknown directionality == | |
| − | * [[RXN- | + | |
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | == | + | |
| − | + | ||
| − | + | ||
== External links == | == External links == | ||
| − | {{#set: | + | * PUBCHEM: |
| − | {{#set: | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=7140377 7140377] |
| − | {{#set: | + | * CHEMSPIDER: |
| − | {{#set: | + | ** [http://www.chemspider.com/Chemical-Structure.394672.html 394672] |
| − | {{#set: | + | * CHEBI: |
| − | {{#set: | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=1235722 1235722] |
| + | {{#set: smiles=C(OP([O-])(=O)[O-])C1(C(O)C(O)C(O)O1)}} | ||
| + | {{#set: common name=β-D-ribose 5-phosphate}} | ||
| + | {{#set: inchi key=InChIKey=KTVPXOYAKDPRHY-TXICZTDVSA-L}} | ||
| + | {{#set: molecular weight=228.095 }} | ||
| + | {{#set: common name=β-D-ribofuranose 5-phosphate|5-O-phosphono-β-D-ribofuranose}} | ||
| + | {{#set: consumed by=RXN-15346}} | ||
| + | {{#set: produced by=RXN-15345}} | ||
Latest revision as of 21:12, 21 March 2018
Contents
Metabolite CPD-16551
- smiles:
- C(OP([O-])(=O)[O-])C1(C(O)C(O)C(O)O1)
- common name:
- β-D-ribose 5-phosphate
- inchi key:
- InChIKey=KTVPXOYAKDPRHY-TXICZTDVSA-L
- molecular weight:
- 228.095
- Synonym(s):
- β-D-ribofuranose 5-phosphate
- 5-O-phosphono-β-D-ribofuranose
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"C(OP([O-])(=O)[O-])C1(C(O)C(O)C(O)O1)" cannot be used as a page name in this wiki.
