Difference between revisions of "Tiso gene 18238"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=HYDRPHENYLAC-CPD HYDRPHENYLAC-CPD] == * smiles: ** [CH](=O)CC1(C=CC(O)=CC=1) * inchi key: ** In...") |
(Created page with "Category:Gene == Gene Tiso_gene_18238 == * right end position: ** 1404 * transcription direction: ** POSITIVE * left end position: ** 603 * centisome position: ** 19.14893...") |
||
(2 intermediate revisions by the same user not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Gene]] |
− | == | + | == Gene Tiso_gene_18238 == |
− | * | + | * right end position: |
− | ** | + | ** 1404 |
− | * | + | * transcription direction: |
− | ** | + | ** POSITIVE |
− | * | + | * left end position: |
− | ** | + | ** 603 |
− | * | + | * centisome position: |
− | ** | + | ** 19.148937 |
* Synonym(s): | * Synonym(s): | ||
− | |||
− | == | + | == Reactions associated == |
− | * [[ | + | * Reaction: [[RXN0-5021]] |
− | + | ** Source: [[annotation-in-silico_annotation]] | |
− | * [[ | + | *** Assignment: automated-name-match |
− | == | + | == Pathways associated == |
== External links == | == External links == | ||
− | + | {{#set: right end position=1404}} | |
− | + | {{#set: transcription direction=POSITIVE}} | |
− | + | {{#set: left end position=603}} | |
− | + | {{#set: centisome position=19.148937 }} | |
− | + | {{#set: reaction associated=RXN0-5021}} | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | + | ||
− | + |
Latest revision as of 20:12, 21 March 2018
Gene Tiso_gene_18238
- right end position:
- 1404
- transcription direction:
- POSITIVE
- left end position:
- 603
- centisome position:
- 19.148937
- Synonym(s):
Reactions associated
- Reaction: RXN0-5021
- Source: annotation-in-silico_annotation
- Assignment: automated-name-match
- Source: annotation-in-silico_annotation