Difference between revisions of "MALEATE"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Unwound-RNA Unwound-RNA] == * common name: ** an unwound RNA * Synonym(s): == Reaction(s) know...")
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=MALEATE MALEATE] == * smiles: ** C([O-])(=O)C=CC([O-])=O * common name: ** maleate * inchi key:...")
 
(2 intermediate revisions by the same user not shown)
Line 1: Line 1:
 
[[Category:Metabolite]]
 
[[Category:Metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Unwound-RNA Unwound-RNA] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=MALEATE MALEATE] ==
 +
* smiles:
 +
** C([O-])(=O)C=CC([O-])=O
 
* common name:
 
* common name:
** an unwound RNA
+
** maleate
 +
* inchi key:
 +
** InChIKey=VZCYOOQTPOCHFL-UPHRSURJSA-L
 +
* molecular weight:
 +
** 114.057   
 
* Synonym(s):
 
* Synonym(s):
 +
** maleic acid
 +
** cis-butenedioic acid
  
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-11109]]
+
* [[RXN-646]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
 
== External links  ==
 
== External links  ==
{{#set: common name=an unwound RNA}}
+
* CAS : 110-16-7
{{#set: produced by=RXN-11109}}
+
* PUBCHEM:
 +
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=5288227 5288227]
 +
* HMDB : HMDB00176
 +
* LIGAND-CPD:
 +
** [http://www.genome.jp/dbget-bin/www_bget?C01384 C01384]
 +
* CHEMSPIDER:
 +
** [http://www.chemspider.com/Chemical-Structure.4450430.html 4450430]
 +
* CHEBI:
 +
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=30780 30780]
 +
{{#set: smiles=C([O-])(=O)C=CC([O-])=O}}
 +
{{#set: common name=maleate}}
 +
{{#set: inchi key=InChIKey=VZCYOOQTPOCHFL-UPHRSURJSA-L}}
 +
{{#set: molecular weight=114.057    }}
 +
{{#set: common name=maleic acid|cis-butenedioic acid}}
 +
{{#set: produced by=RXN-646}}

Latest revision as of 21:12, 21 March 2018

Metabolite MALEATE

  • smiles:
    • C([O-])(=O)C=CC([O-])=O
  • common name:
    • maleate
  • inchi key:
    • InChIKey=VZCYOOQTPOCHFL-UPHRSURJSA-L
  • molecular weight:
    • 114.057
  • Synonym(s):
    • maleic acid
    • cis-butenedioic acid

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"C([O-])(=O)C=CC([O-])=O" cannot be used as a page name in this wiki.