Difference between revisions of "Tiso gene 4719"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=GLC-D-LACTONE GLC-D-LACTONE] == * smiles: ** C(O)C1(OC(C(C(C1O)O)O)=O) * inchi key: ** InChIKey...") |
(Created page with "Category:Gene == Gene Tiso_gene_4719 == * right end position: ** 5461 * transcription direction: ** POSITIVE * left end position: ** 4094 * centisome position: ** 28.36162...") |
||
(2 intermediate revisions by the same user not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Gene]] |
− | == | + | == Gene Tiso_gene_4719 == |
− | * | + | * right end position: |
− | ** | + | ** 5461 |
− | * | + | * transcription direction: |
− | ** | + | ** POSITIVE |
− | * | + | * left end position: |
− | ** | + | ** 4094 |
− | * | + | * centisome position: |
− | ** | + | ** 28.361622 |
* Synonym(s): | * Synonym(s): | ||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | == | + | == Reactions associated == |
− | * [[ | + | * Reaction: [[4OHBENZOATE-OCTAPRENYLTRANSFER-RXN]] |
− | + | ** Source: [[annotation-in-silico_annotation]] | |
− | == | + | *** Assignment: automated-name-match |
− | * [[ | + | * Reaction: [[GPPSYN-RXN]] |
+ | ** Source: [[orthology-esiliculosus]] | ||
+ | == Pathways associated == | ||
+ | * [[PWY-7736]] | ||
+ | * [[PWY-7410]] | ||
+ | * [[PWY-6859]] | ||
+ | * [[PWY-7709]] | ||
+ | * [[PWY-7102]] | ||
+ | * [[PWY-7182]] | ||
+ | * [[PWY-6708]] | ||
+ | * [[PWY-7141]] | ||
+ | * [[PWY-5123]] | ||
+ | * [[PWY-5122]] | ||
+ | * [[PWY-6383]] | ||
+ | * [[PWY-7659]] | ||
+ | * [[PWY-5870]] | ||
== External links == | == External links == | ||
− | + | {{#set: right end position=5461}} | |
− | + | {{#set: transcription direction=POSITIVE}} | |
− | + | {{#set: left end position=4094}} | |
− | + | {{#set: centisome position=28.361622 }} | |
− | + | {{#set: reaction associated=4OHBENZOATE-OCTAPRENYLTRANSFER-RXN|GPPSYN-RXN}} | |
− | + | {{#set: pathway associated=PWY-7736|PWY-7410|PWY-6859|PWY-7709|PWY-7102|PWY-7182|PWY-6708|PWY-7141|PWY-5123|PWY-5122|PWY-6383|PWY-7659|PWY-5870}} | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | + | ||
− | + |
Latest revision as of 20:12, 21 March 2018
Gene Tiso_gene_4719
- right end position:
- 5461
- transcription direction:
- POSITIVE
- left end position:
- 4094
- centisome position:
- 28.361622
- Synonym(s):
Reactions associated
- Reaction: 4OHBENZOATE-OCTAPRENYLTRANSFER-RXN
- Source: annotation-in-silico_annotation
- Assignment: automated-name-match
- Source: annotation-in-silico_annotation
- Reaction: GPPSYN-RXN
- Source: orthology-esiliculosus
Pathways associated
- PWY-7736
- PWY-7410
- PWY-6859
- PWY-7709
- PWY-7102
- PWY-7182
- PWY-6708
- PWY-7141
- PWY-5123
- PWY-5122
- PWY-6383
- PWY-7659
- PWY-5870