Difference between revisions of "HDS"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=GLC-1-P GLC-1-P] == * smiles: ** C(O)C1(OC(OP(=O)([O-])[O-])C(O)C(O)C(O)1) * inchi key: ** InCh...") |
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=HDS HDS] == * direction: ** REVERSIBLE * common name: ** 4-hydroxy-3-methylbut-2-en-1-yl diphosphat...") |
||
| (2 intermediate revisions by the same user not shown) | |||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:Reaction]] |
| − | == | + | == Reaction [http://metacyc.org/META/NEW-IMAGE?object=HDS HDS] == |
| − | * | + | * direction: |
| − | ** | + | ** REVERSIBLE |
| − | + | ||
| − | + | ||
* common name: | * common name: | ||
| − | ** | + | ** 4-hydroxy-3-methylbut-2-en-1-yl diphosphate synthase |
| − | + | ||
| − | + | ||
* Synonym(s): | * Synonym(s): | ||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | == Reaction | + | == Reaction Formula == |
| − | * [[ | + | * With identifiers: |
| − | + | ** 1.0 [[2C-METH-D-ERYTHRITOL-CYCLODIPHOSPHATE]][h] '''+''' 1.0 [[Protein-Dithiols]][h] '''<=>''' 1.0 [[Protein-Disulfides]][h] '''+''' 1.0 [[PROTON]][h] '''+''' 1.0 [[WATER]][h] '''+''' 1.0 [[HYDROXY-METHYL-BUTENYL-DIP]][h] | |
| − | + | * With common name(s): | |
| − | + | ** 1.0 2-C-methyl-D-erythritol-2,4-cyclodiphosphate[h] '''+''' 1.0 a protein dithiol[h] '''<=>''' 1.0 a protein disulfide[h] '''+''' 1.0 H+[h] '''+''' 1.0 H2O[h] '''+''' 1.0 (E)-4-hydroxy-3-methylbut-2-en-1-yl diphosphate[h] | |
| − | + | ||
| − | + | == Genes associated with this reaction == | |
| − | + | Genes have been associated with this reaction based on different elements listed below. | |
| − | + | * Gene: [[Tiso_gene_15758]] | |
| − | + | ** Source: [[orthology-creinhardtii]] | |
| − | + | == Pathways == | |
| − | + | == Reconstruction information == | |
| − | * [[ | + | * Category: [[orthology]] |
| − | + | ** Source: [[orthology-creinhardtii]] | |
| − | + | *** Tool: [[pantograph]] | |
| − | + | ||
| − | + | ||
| − | + | ||
| − | * [[ | + | |
| − | * [[ | + | |
| − | * [[ | + | |
| − | * [[ | + | |
| − | * | + | |
| − | * [[ | + | |
== External links == | == External links == | ||
| − | + | {{#set: direction=REVERSIBLE}} | |
| − | + | {{#set: common name=4-hydroxy-3-methylbut-2-en-1-yl diphosphate synthase}} | |
| − | + | {{#set: gene associated=Tiso_gene_15758}} | |
| − | + | {{#set: in pathway=}} | |
| − | + | {{#set: reconstruction category=orthology}} | |
| − | + | {{#set: reconstruction source=orthology-creinhardtii}} | |
| − | + | {{#set: reconstruction tool=pantograph}} | |
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | {{#set: | + | |
| − | + | ||
| − | {{#set: common name= | + | |
| − | {{#set: | + | |
| − | {{#set: | + | |
| − | {{#set: | + | |
| − | {{#set: | + | |
| − | {{#set: | + | |
Latest revision as of 20:13, 21 March 2018
Contents
Reaction HDS
- direction:
- REVERSIBLE
- common name:
- 4-hydroxy-3-methylbut-2-en-1-yl diphosphate synthase
- Synonym(s):
Reaction Formula
- With identifiers:
- 1.0 2C-METH-D-ERYTHRITOL-CYCLODIPHOSPHATE[h] + 1.0 Protein-Dithiols[h] <=> 1.0 Protein-Disulfides[h] + 1.0 PROTON[h] + 1.0 WATER[h] + 1.0 HYDROXY-METHYL-BUTENYL-DIP[h]
- With common name(s):
- 1.0 2-C-methyl-D-erythritol-2,4-cyclodiphosphate[h] + 1.0 a protein dithiol[h] <=> 1.0 a protein disulfide[h] + 1.0 H+[h] + 1.0 H2O[h] + 1.0 (E)-4-hydroxy-3-methylbut-2-en-1-yl diphosphate[h]
Genes associated with this reaction
Genes have been associated with this reaction based on different elements listed below.
- Gene: Tiso_gene_15758
- Source: orthology-creinhardtii
Pathways
Reconstruction information
- Category: orthology
- Source: orthology-creinhardtii
- Tool: pantograph
- Source: orthology-creinhardtii
