Difference between revisions of "RNA-3-PHOSPHATE-CYCLASE-RXN"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-13935 CPD-13935] == * smiles: ** C2(O)(OC(COC1(OC(CO)C(O)C(O)C(O)1))C(O)C(O)C(O)2) * inchi...") |
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RNA-3-PHOSPHATE-CYCLASE-RXN RNA-3-PHOSPHATE-CYCLASE-RXN] == * direction: ** LEFT-TO-RIGHT * ec numb...") |
||
(3 intermediate revisions by the same user not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Reaction]] |
− | == | + | == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RNA-3-PHOSPHATE-CYCLASE-RXN RNA-3-PHOSPHATE-CYCLASE-RXN] == |
− | * | + | * direction: |
− | ** | + | ** LEFT-TO-RIGHT |
− | + | * ec number: | |
− | + | ** [http://enzyme.expasy.org/EC/6.5.1.4 EC-6.5.1.4] | |
− | * | + | |
− | ** | + | |
− | + | ||
− | + | ||
* Synonym(s): | * Synonym(s): | ||
− | |||
− | == Reaction | + | == Reaction Formula == |
− | = | + | * With identifiers: |
− | * [[3 | + | ** 1 [[3-Prime-Phosphate-Terminated-RNAs]][c] '''+''' 1 [[ATP]][c] '''=>''' 1 [[AMP]][c] '''+''' 1 [[PPI]][c] '''+''' 1 [[Cyclic-Phosphate-Terminated-RNAs]][c] |
− | == | + | * With common name(s): |
+ | ** 1 an [RNA]-3'-(3'-phospho-ribonucleoside)[c] '''+''' 1 ATP[c] '''=>''' 1 AMP[c] '''+''' 1 diphosphate[c] '''+''' 1 an [RNA]-3'-(2',3'-cyclophospho)-ribunucleoside[c] | ||
+ | |||
+ | == Genes associated with this reaction == | ||
+ | Genes have been associated with this reaction based on different elements listed below. | ||
+ | * Gene: [[Tiso_gene_18788]] | ||
+ | ** Source: [[orthology-esiliculosus]] | ||
+ | == Pathways == | ||
+ | == Reconstruction information == | ||
+ | * Category: [[orthology]] | ||
+ | ** Source: [[orthology-esiliculosus]] | ||
+ | *** Tool: [[pantograph]] | ||
== External links == | == External links == | ||
− | * LIGAND- | + | * LIGAND-RXN: |
− | ** [http://www.genome.jp/dbget-bin/www_bget? | + | ** [http://www.genome.jp/dbget-bin/www_bget?R04274 R04274] |
− | * | + | * UNIPROT: |
− | ** [http://www. | + | ** [http://www.uniprot.org/uniprot/Q9V0Z6 Q9V0Z6] |
− | + | ** [http://www.uniprot.org/uniprot/O00442 O00442] | |
− | ** [http://www. | + | {{#set: direction=LEFT-TO-RIGHT}} |
− | + | {{#set: ec number=EC-6.5.1.4}} | |
− | + | {{#set: gene associated=Tiso_gene_18788}} | |
− | {{#set: | + | {{#set: in pathway=}} |
− | {{#set: | + | {{#set: reconstruction category=orthology}} |
− | {{#set: | + | {{#set: reconstruction source=orthology-esiliculosus}} |
− | {{#set: | + | {{#set: reconstruction tool=pantograph}} |
− | {{#set: | + | |
− | {{#set: | + |
Latest revision as of 19:20, 21 March 2018
Contents
Reaction RNA-3-PHOSPHATE-CYCLASE-RXN
- direction:
- LEFT-TO-RIGHT
- ec number:
- Synonym(s):
Reaction Formula
- With identifiers:
- 1 3-Prime-Phosphate-Terminated-RNAs[c] + 1 ATP[c] => 1 AMP[c] + 1 PPI[c] + 1 Cyclic-Phosphate-Terminated-RNAs[c]
- With common name(s):
- 1 an [RNA]-3'-(3'-phospho-ribonucleoside)[c] + 1 ATP[c] => 1 AMP[c] + 1 diphosphate[c] + 1 an [RNA]-3'-(2',3'-cyclophospho)-ribunucleoside[c]
Genes associated with this reaction
Genes have been associated with this reaction based on different elements listed below.
- Gene: Tiso_gene_18788
- Source: orthology-esiliculosus
Pathways
Reconstruction information
- Category: orthology
- Source: orthology-esiliculosus
- Tool: pantograph
- Source: orthology-esiliculosus
External links