Difference between revisions of "Tiso gene 20054"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=OROTATE OROTATE] == * smiles: ** C1(=C(C([O-])=O)NC(NC(=O)1)=O) * inchi key: ** InChIKey=PXQPEW...")
(Created page with "Category:Gene == Gene Tiso_gene_20054 == * right end position: ** 723 * transcription direction: ** POSITIVE * left end position: ** 8 * centisome position: ** 0.44469148...")
 
(2 intermediate revisions by the same user not shown)
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Gene]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=OROTATE OROTATE] ==
+
== Gene Tiso_gene_20054 ==
−
* smiles:
+
* right end position:
−
** C1(=C(C([O-])=O)NC(NC(=O)1)=O)
+
** 723
−
* inchi key:
+
* transcription direction:
−
** InChIKey=PXQPEWDEAKTCGB-UHFFFAOYSA-M
+
** POSITIVE
−
* common name:
+
* left end position:
−
** orotate
+
** 8
−
* molecular weight:
+
* centisome position:
−
** 155.09    
+
** 0.44469148    
 
* Synonym(s):
 
* Synonym(s):
−
** orotic acid
+
** FNR
  
−
== Reaction(s) known to consume the compound ==
+
== Reactions associated ==
−
* [[RXN0-6490]]
+
* Reaction: [[1.18.1.2-RXN]]
−
== Reaction(s) known to produce the compound ==
+
** Source: [[annotation-in-silico_annotation]]
−
* [[RXN0-6491]]
+
*** Assignment: ec-number
−
* [[RXN0-6554]]
+
** Source: [[annotation-experimental_annotation]]
−
* [[DIHYDROOROTATE-DEHYDROGENASE-RXN]]
+
*** Assignment: ec-number
−
* [[RXN-9929]]
+
* Reaction: [[RXN-17897]]
−
== Reaction(s) of unknown directionality ==
+
** Source: [[annotation-in-silico_annotation]]
−
* [[OROPRIBTRANS-RXN]]
+
*** Assignment: ec-number
−
* [[orPRT]]
+
** Source: [[annotation-experimental_annotation]]
 +
*** Assignment: ec-number
 +
== Pathways associated ==
 +
* [[PWY-7230]]
 +
* [[PWY-101]]
 
== External links  ==
 
== External links  ==
−
* CAS : 65-86-1
+
{{#set: right end position=723}}
−
* METABOLIGHTS : MTBLC30839
+
{{#set: transcription direction=POSITIVE}}
−
* PUBCHEM:
+
{{#set: left end position=8}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=1492348 1492348]
+
{{#set: centisome position=0.44469148   }}
−
* HMDB : HMDB00226
+
{{#set: common name=FNR}}
−
* LIGAND-CPD:
+
{{#set: reaction associated=1.18.1.2-RXN|RXN-17897}}
−
** [http://www.genome.jp/dbget-bin/www_bget?C00295 C00295]
+
{{#set: pathway associated=PWY-7230|PWY-101}}
−
* CHEBI:
+
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=30839 30839]
+
−
* BIGG : orot
+
−
{{#set: smiles=C1(=C(C([O-])=O)NC(NC(=O)1)=O)}}
+
−
{{#set: inchi key=InChIKey=PXQPEWDEAKTCGB-UHFFFAOYSA-M}}
+
−
{{#set: common name=orotate}}
+
−
{{#set: molecular weight=155.09   }}
+
−
{{#set: common name=orotic acid}}
+
−
{{#set: consumed by=RXN0-6490}}
+
−
{{#set: produced by=RXN0-6491|RXN0-6554|DIHYDROOROTATE-DEHYDROGENASE-RXN|RXN-9929}}
+
−
{{#set: consumed or produced by=OROPRIBTRANS-RXN|orPRT}}
+

Latest revision as of 20:13, 21 March 2018

Gene Tiso_gene_20054

  • right end position:
    • 723
  • transcription direction:
    • POSITIVE
  • left end position:
    • 8
  • centisome position:
    • 0.44469148
  • Synonym(s):
    • FNR

Reactions associated

Pathways associated

External links

Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=Tiso_gene_20054&oldid=46918"