Difference between revisions of "ERYTHROSE-4P"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Double-helix-DNA Double-helix-DNA] == * common name: ** a double-helix DNA * Synonym(s): == Re...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=ERYTHROSE-4P ERYTHROSE-4P] == * smiles: ** [CH](C(C(COP([O-])([O-])=O)O)O)=O * common name: **...") |
||
(2 intermediate revisions by the same user not shown) | |||
Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
− | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=ERYTHROSE-4P ERYTHROSE-4P] == |
+ | * smiles: | ||
+ | ** [CH](C(C(COP([O-])([O-])=O)O)O)=O | ||
* common name: | * common name: | ||
− | ** | + | ** D-erythrose 4-phosphate |
+ | * inchi key: | ||
+ | ** InChIKey=NGHMDNPXVRFFGS-IUYQGCFVSA-L | ||
+ | * molecular weight: | ||
+ | ** 198.069 | ||
* Synonym(s): | * Synonym(s): | ||
+ | ** erythrose-4P | ||
+ | ** threose 4-phosphate | ||
+ | ** erythrose-4-phosphate | ||
+ | ** erythrose-4-P | ||
+ | ** D-erythrose-4-P | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | * [[RXN- | + | * [[DAHPSYN-RXN]] |
+ | * [[R01067]] | ||
+ | * [[TRANSALDOL-RXN]] | ||
+ | * [[R08575]] | ||
+ | * [[2TRANSKETO-RXN]] | ||
+ | * [[SEDOBISALDOL-RXN]] | ||
== External links == | == External links == | ||
− | {{#set: common name= | + | * CAS : 585-18-2 |
− | {{#set: | + | * BIGG : e4p |
+ | * PUBCHEM: | ||
+ | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=5459862 5459862] | ||
+ | * HMDB : HMDB01321 | ||
+ | * LIGAND-CPD: | ||
+ | ** [http://www.genome.jp/dbget-bin/www_bget?C00279 C00279] | ||
+ | * CHEMSPIDER: | ||
+ | ** [http://www.chemspider.com/Chemical-Structure.4573609.html 4573609] | ||
+ | * CHEBI: | ||
+ | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=16897 16897] | ||
+ | * METABOLIGHTS : MTBLC16897 | ||
+ | {{#set: smiles=[CH](C(C(COP([O-])([O-])=O)O)O)=O}} | ||
+ | {{#set: common name=D-erythrose 4-phosphate}} | ||
+ | {{#set: inchi key=InChIKey=NGHMDNPXVRFFGS-IUYQGCFVSA-L}} | ||
+ | {{#set: molecular weight=198.069 }} | ||
+ | {{#set: common name=erythrose-4P|threose 4-phosphate|erythrose-4-phosphate|erythrose-4-P|D-erythrose-4-P}} | ||
+ | {{#set: reversible reaction associated=DAHPSYN-RXN|R01067|TRANSALDOL-RXN|R08575|2TRANSKETO-RXN|SEDOBISALDOL-RXN}} |
Latest revision as of 20:13, 21 March 2018
Contents
Metabolite ERYTHROSE-4P
- smiles:
- [CH](C(C(COP([O-])([O-])=O)O)O)=O
- common name:
- D-erythrose 4-phosphate
- inchi key:
- InChIKey=NGHMDNPXVRFFGS-IUYQGCFVSA-L
- molecular weight:
- 198.069
- Synonym(s):
- erythrose-4P
- threose 4-phosphate
- erythrose-4-phosphate
- erythrose-4-P
- D-erythrose-4-P
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
- CAS : 585-18-2
- BIGG : e4p
- PUBCHEM:
- HMDB : HMDB01321
- LIGAND-CPD:
- CHEMSPIDER:
- CHEBI:
- METABOLIGHTS : MTBLC16897
"CH](C(C(COP([O-])([O-])=O)O)O)=O" cannot be used as a page name in this wiki.