Difference between revisions of "RXN-16557"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=2-METHYL-3-HYDROXY-BUTYRYL-COA 2-METHYL-3-HYDROXY-BUTYRYL-COA] == * smiles: ** CC(C(=O)SCCNC(=O...")
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-16557 RXN-16557] == * direction: ** LEFT-TO-RIGHT * common name: ** acyl-coenzyme_a_oxidase **...")
 
(2 intermediate revisions by the same user not shown)
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Reaction]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=2-METHYL-3-HYDROXY-BUTYRYL-COA 2-METHYL-3-HYDROXY-BUTYRYL-COA] ==
+
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-16557 RXN-16557] ==
−
* smiles:
+
* direction:
−
** CC(C(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-])C(C)O
+
** LEFT-TO-RIGHT
−
* inchi key:
+
−
** InChIKey=PEKYNTFSOBAABV-LQUDNSJZSA-J
+
 
* common name:
 
* common name:
−
** (2S,3S)-3-hydroxy-2-methylbutanoyl-CoA
+
** acyl-coenzyme_a_oxidase
−
* molecular weight:
+
** acyl-_dehydrogenase
−
** 863.619   
+
** ORF
 +
** acyl-CoA_dehydrogenase
 +
* ec number:
 +
** [http://enzyme.expasy.org/EC/1.3.8.9 EC-1.3.8.9]
 
* Synonym(s):
 
* Synonym(s):
−
** 2-methyl-3-hydroxybutyryl-CoA
 
−
** (2S,3S)-3-hydroxy-2-methylbutyryl-CoA
 
−
** (S)-3-hydroxy-2-methylbutyryl-CoA
 
−
** 3-hydroxy-2-methylbutyryl-CoA
 
  
−
== Reaction(s) known to consume the compound ==
+
== Reaction Formula ==
−
== Reaction(s) known to produce the compound ==
+
* With identifiers:
−
== Reaction(s) of unknown directionality ==
+
** 1 [[ETF-Oxidized]][c] '''+''' 1 [[PROTON]][c] '''+''' 1 [[CPD-16001]][c] '''=>''' 1 [[ETF-Reduced]][c] '''+''' 1 [[CPD-17813]][c]
−
* [[TIGLYLCOA-HYDROXY-RXN]]
+
* With common name(s):
−
* [[HMNOS]]
+
** 1 an oxidized electron-transfer flavoprotein[c] '''+''' 1 H+[c] '''+''' 1 (11Z)-hexadecenoyl-CoA[c] '''=>''' 1 a reduced electron-transfer flavoprotein[c] '''+''' 1 (2E,11Z)-hexadec-2,11-dienoyl-CoA[c]
 +
 
 +
== Genes associated with this reaction  ==
 +
Genes have been associated with this reaction based on different elements listed below.
 +
* Gene: [[Tiso_gene_17967]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Assignment: EC-NUMBER
 +
* Gene: [[Tiso_gene_18566]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Assignment: EC-NUMBER
 +
* Gene: [[Tiso_gene_883]]
 +
** Source: [[annotation-experimental_annotation]]
 +
*** Assignment: EC-NUMBER
 +
* Gene: [[Tiso_gene_5991]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Assignment: EC-NUMBER
 +
* Gene: [[Tiso_gene_16631]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Assignment: EC-NUMBER
 +
* Gene: [[Tiso_gene_6475]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Assignment: EC-NUMBER
 +
== Pathways  ==
 +
* [[PWY-7656]], Spodoptera littoralis pheromone biosynthesis: [http://metacyc.org/META/NEW-IMAGE?object=PWY-7656 PWY-7656]
 +
** '''6''' reactions found over '''22''' reactions in the full pathway
 +
== Reconstruction information  ==
 +
* Category: [[annotation]]
 +
** Source: [[annotation-experimental_annotation]]
 +
*** Tool: [[pathwaytools]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Tool: [[pathwaytools]]
 
== External links  ==
 
== External links  ==
−
* PUBCHEM:
+
{{#set: direction=LEFT-TO-RIGHT}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=90657672 90657672]
+
{{#set: common name=acyl-coenzyme_a_oxidase}}
−
* CHEBI:
+
{{#set: common name=acyl-_dehydrogenase}}
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=15449 15449]
+
{{#set: common name=ORF}}
−
* LIGAND-CPD:
+
{{#set: common name=acyl-CoA_dehydrogenase}}
−
** [http://www.genome.jp/dbget-bin/www_bget?C04405 C04405]
+
{{#set: ec number=EC-1.3.8.9}}
−
* HMDB : HMDB01356
+
{{#set: gene associated=Tiso_gene_17967|Tiso_gene_18566|Tiso_gene_883|Tiso_gene_5991|Tiso_gene_16631|Tiso_gene_6475}}
−
{{#set: smiles=CC(C(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-])C(C)O}}
+
{{#set: in pathway=PWY-7656}}
−
{{#set: inchi key=InChIKey=PEKYNTFSOBAABV-LQUDNSJZSA-J}}
+
{{#set: reconstruction category=annotation}}
−
{{#set: common name=(2S,3S)-3-hydroxy-2-methylbutanoyl-CoA}}
+
{{#set: reconstruction source=annotation-experimental_annotation|annotation-in-silico_annotation}}
−
{{#set: molecular weight=863.619    }}
+
{{#set: reconstruction tool=pathwaytools}}
−
{{#set: common name=2-methyl-3-hydroxybutyryl-CoA|(2S,3S)-3-hydroxy-2-methylbutyryl-CoA|(S)-3-hydroxy-2-methylbutyryl-CoA|3-hydroxy-2-methylbutyryl-CoA}}
+
−
{{#set: consumed or produced by=TIGLYLCOA-HYDROXY-RXN|HMNOS}}
+

Latest revision as of 20:13, 21 March 2018

Reaction RXN-16557

  • direction:
    • LEFT-TO-RIGHT
  • common name:
    • acyl-coenzyme_a_oxidase
    • acyl-_dehydrogenase
    • ORF
    • acyl-CoA_dehydrogenase
  • ec number:
  • Synonym(s):

Reaction Formula

  • With identifiers:
  • With common name(s):
    • 1 an oxidized electron-transfer flavoprotein[c] + 1 H+[c] + 1 (11Z)-hexadecenoyl-CoA[c] => 1 a reduced electron-transfer flavoprotein[c] + 1 (2E,11Z)-hexadec-2,11-dienoyl-CoA[c]

Genes associated with this reaction

Genes have been associated with this reaction based on different elements listed below.

Pathways

  • PWY-7656, Spodoptera littoralis pheromone biosynthesis: PWY-7656
    • 6 reactions found over 22 reactions in the full pathway

Reconstruction information

External links

Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=RXN-16557&oldid=47002"