Difference between revisions of "Tiso gene 14664"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=QUEUINE QUEUINE] == * smiles: ** C([N+]C1(C=CC(O)C(O)1))C2(=CNC3(N=C(NC(=O)C2=3)N)) * inchi key...")
(Created page with "Category:Gene == Gene Tiso_gene_14664 == * right end position: ** 5495 * transcription direction: ** NEGATIVE * left end position: ** 1050 * centisome position: ** 19.0631...")
 
(2 intermediate revisions by the same user not shown)
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Gene]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=QUEUINE QUEUINE] ==
+
== Gene Tiso_gene_14664 ==
−
* smiles:
+
* right end position:
−
** C([N+]C1(C=CC(O)C(O)1))C2(=CNC3(N=C(NC(=O)C2=3)N))
+
** 5495
−
* inchi key:
+
* transcription direction:
−
** InChIKey=WYROLENTHWJFLR-ACLDMZEESA-O
+
** NEGATIVE
−
* common name:
+
* left end position:
−
** queuine
+
** 1050
−
* molecular weight:
+
* centisome position:
−
** 278.29    
+
** 19.06318    
 
* Synonym(s):
 
* Synonym(s):
−
** 7-(3,4-trans-4,5-cis-dihydroxy-1-cyclopenten-3-ylaminomethyl)-7-deazaguanine
 
−
** base Q
 
  
−
== Reaction(s) known to consume the compound ==
+
== Reactions associated ==
−
== Reaction(s) known to produce the compound ==
+
* Reaction: [[3PGAREARR-RXN]]
−
== Reaction(s) of unknown directionality ==
+
** Source: [[annotation-in-silico_annotation]]
−
* [[QUEUOSINE-TRNA-RIBOSYLTRANSFERASE-RXN]]
+
*** Assignment: ec-number
 +
* Reaction: [[RXN-15509]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Assignment: ec-number
 +
* Reaction: [[RXN-15510]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Assignment: ec-number
 +
* Reaction: [[RXN-15511]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Assignment: ec-number
 +
* Reaction: [[RXN-15512]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Assignment: ec-number
 +
* Reaction: [[RXN-15513]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Assignment: ec-number
 +
== Pathways associated ==
 +
* [[PWY-1042]]
 +
* [[P341-PWY]]
 +
* [[PWY-2221]]
 +
* [[PWY-1622]]
 +
* [[GLUCONEO-PWY]]
 +
* [[GLYCOLYSIS]]
 +
* [[PWY-6901]]
 +
* [[ANAGLYCOLYSIS-PWY]]
 +
* [[PWY-7218]]
 +
* [[PWY-6405]]
 +
* [[P124-PWY]]
 +
* [[PWY-6886]]
 +
* [[PWY66-399]]
 +
* [[PWY-5723]]
 +
* [[PWY-6142]]
 +
* [[PWY-5484]]
 +
* [[PWY-7124]]
 +
* [[P122-PWY]]
 +
* [[PWY-7003]]
 
== External links  ==
 
== External links  ==
−
* PUBCHEM:
+
{{#set: right end position=5495}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=86289319 86289319]
+
{{#set: transcription direction=NEGATIVE}}
−
* CHEBI:
+
{{#set: left end position=1050}}
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=77674 77674]
+
{{#set: centisome position=19.06318   }}
−
* HMDB : HMDB01495
+
{{#set: reaction associated=3PGAREARR-RXN|RXN-15509|RXN-15510|RXN-15511|RXN-15512|RXN-15513}}
−
{{#set: smiles=C([N+]C1(C=CC(O)C(O)1))C2(=CNC3(N=C(NC(=O)C2=3)N))}}
+
{{#set: pathway associated=PWY-1042|P341-PWY|PWY-2221|PWY-1622|GLUCONEO-PWY|GLYCOLYSIS|PWY-6901|ANAGLYCOLYSIS-PWY|PWY-7218|PWY-6405|P124-PWY|PWY-6886|PWY66-399|PWY-5723|PWY-6142|PWY-5484|PWY-7124|P122-PWY|PWY-7003}}
−
{{#set: inchi key=InChIKey=WYROLENTHWJFLR-ACLDMZEESA-O}}
+
−
{{#set: common name=queuine}}
+
−
{{#set: molecular weight=278.29   }}
+
−
{{#set: common name=7-(3,4-trans-4,5-cis-dihydroxy-1-cyclopenten-3-ylaminomethyl)-7-deazaguanine|base Q}}
+
−
{{#set: consumed or produced by=QUEUOSINE-TRNA-RIBOSYLTRANSFERASE-RXN}}
+

Latest revision as of 20:14, 21 March 2018

Gene Tiso_gene_14664

  • right end position:
    • 5495
  • transcription direction:
    • NEGATIVE
  • left end position:
    • 1050
  • centisome position:
    • 19.06318
  • Synonym(s):

Reactions associated

Pathways associated

External links

Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=Tiso_gene_14664&oldid=47013"