Difference between revisions of "GCLDH"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=THIAMINE THIAMINE] == * smiles: ** CC1([N+](=CSC(CCO)=1)CC2(C=NC(C)=NC(N)=2)) * inchi key: ** I...") |
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=GCLDH GCLDH] == * direction: ** LEFT-TO-RIGHT * common name: ** Glycolate dehydrogenase * Synonym(s...") |
||
(2 intermediate revisions by the same user not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Reaction]] |
− | == | + | == Reaction [http://metacyc.org/META/NEW-IMAGE?object=GCLDH GCLDH] == |
− | * | + | * direction: |
− | ** | + | ** LEFT-TO-RIGHT |
− | + | ||
− | + | ||
* common name: | * common name: | ||
− | ** | + | ** Glycolate dehydrogenase |
− | + | ||
− | + | ||
* Synonym(s): | * Synonym(s): | ||
− | |||
− | |||
− | == Reaction | + | == Reaction Formula == |
− | * [[ | + | * With identifiers: |
− | * [[ | + | ** 1.0 [[GLYCOLLATE]][m] '''+''' 1.0 [[Oxidized-ferredoxins]][m] '''=>''' 1.0 [[GLYOX]][m] '''+''' 1.0 [[Reduced-ferredoxins]][m] |
− | + | * With common name(s): | |
− | == | + | ** 1.0 glycolate[m] '''+''' 1.0 an oxidized ferredoxin [iron-sulfur] cluster[m] '''=>''' 1.0 glyoxylate[m] '''+''' 1.0 a reduced ferredoxin [iron-sulfur] cluster[m] |
− | * [[ | + | |
− | * [[ | + | == Genes associated with this reaction == |
− | == | + | Genes have been associated with this reaction based on different elements listed below. |
− | * [[ | + | * Gene: [[Tiso_gene_6420]] |
+ | ** Source: [[orthology-creinhardtii]] | ||
+ | * Gene: [[Tiso_gene_17319]] | ||
+ | ** Source: [[orthology-creinhardtii]] | ||
+ | == Pathways == | ||
+ | == Reconstruction information == | ||
+ | * Category: [[orthology]] | ||
+ | ** Source: [[orthology-creinhardtii]] | ||
+ | *** Tool: [[pantograph]] | ||
== External links == | == External links == | ||
− | + | {{#set: direction=LEFT-TO-RIGHT}} | |
− | + | {{#set: common name=Glycolate dehydrogenase}} | |
− | + | {{#set: gene associated=Tiso_gene_6420|Tiso_gene_17319}} | |
− | + | {{#set: in pathway=}} | |
− | + | {{#set: reconstruction category=orthology}} | |
− | + | {{#set: reconstruction source=orthology-creinhardtii}} | |
− | + | {{#set: reconstruction tool=pantograph}} | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | {{#set: | + | |
− | + | ||
− | {{#set: common name= | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + |
Latest revision as of 20:14, 21 March 2018
Contents
Reaction GCLDH
- direction:
- LEFT-TO-RIGHT
- common name:
- Glycolate dehydrogenase
- Synonym(s):
Reaction Formula
- With identifiers:
- 1.0 GLYCOLLATE[m] + 1.0 Oxidized-ferredoxins[m] => 1.0 GLYOX[m] + 1.0 Reduced-ferredoxins[m]
- With common name(s):
- 1.0 glycolate[m] + 1.0 an oxidized ferredoxin [iron-sulfur] cluster[m] => 1.0 glyoxylate[m] + 1.0 a reduced ferredoxin [iron-sulfur] cluster[m]
Genes associated with this reaction
Genes have been associated with this reaction based on different elements listed below.
- Gene: Tiso_gene_6420
- Source: orthology-creinhardtii
- Gene: Tiso_gene_17319
- Source: orthology-creinhardtii
Pathways
Reconstruction information
- Category: orthology
- Source: orthology-creinhardtii
- Tool: pantograph
- Source: orthology-creinhardtii