Difference between revisions of "CPD-9459"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Gene == Gene Tiso_gene_5254 == * left end position: ** 747 * transcription direction: ** POSITIVE * right end position: ** 2095 * centisome position: ** 5.4485774...")
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-9459 CPD-9459] == * smiles: ** CC3(C[CH]4(C2(=CC[CH]5(C1(CCC(C([CH]1CCC(C2(CCC(CC3)4C([O-])...")
 
(2 intermediate revisions by the same user not shown)
Line 1: Line 1:
[[Category:Gene]]
+
[[Category:Metabolite]]
== Gene Tiso_gene_5254 ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-9459 CPD-9459] ==
* left end position:
+
* smiles:
** 747
+
** CC3(C[CH]4(C2(=CC[CH]5(C1(CCC(C([CH]1CCC(C2(CCC(CC3)4C([O-])=O)C)5C)(C)C)O)C))))C
* transcription direction:
+
* common name:
** POSITIVE
+
** oleanolate
* right end position:
+
* inchi key:
** 2095
+
** InChIKey=MIJYXULNPSFWEK-GTOFXWBISA-M
* centisome position:
+
* molecular weight:
** 5.4485774    
+
** 455.699    
 
* Synonym(s):
 
* Synonym(s):
 +
** oleanolic acid
 +
** oleanic acid
 +
** caryophyllin
 +
** 3-beta-Hydroxyolean-12-en-28-oic acid
 +
** oleonolic acid
  
== Reactions associated ==
+
== Reaction(s) known to consume the compound ==
* [[3.1.27.9-RXN]]
+
* [[RXN-9000]]
** in-silico_annotation
+
== Reaction(s) known to produce the compound ==
***ec-number
+
== Reaction(s) of unknown directionality ==
== Pathways associated ==
+
* [[PWY-6689]]
+
* [[PWY-7803]]
+
 
== External links  ==
 
== External links  ==
{{#set: left end position=747}}
+
* PUBCHEM:
{{#set: transcription direction=POSITIVE}}
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=11865404 11865404]
{{#set: right end position=2095}}
+
* CHEMSPIDER:
{{#set: centisome position=5.4485774   }}
+
** [http://www.chemspider.com/Chemical-Structure.10039737.html 10039737]
{{#set: reaction associated=3.1.27.9-RXN}}
+
* CHEBI:
{{#set: pathway associated=PWY-6689|PWY-7803}}
+
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=82828 82828]
 +
* METABOLIGHTS : MTBLC37659
 +
* HMDB : HMDB02364
 +
{{#set: smiles=CC3(C[CH]4(C2(=CC[CH]5(C1(CCC(C([CH]1CCC(C2(CCC(CC3)4C([O-])=O)C)5C)(C)C)O)C))))C}}
 +
{{#set: common name=oleanolate}}
 +
{{#set: inchi key=InChIKey=MIJYXULNPSFWEK-GTOFXWBISA-M}}
 +
{{#set: molecular weight=455.699   }}
 +
{{#set: common name=oleanolic acid|oleanic acid|caryophyllin|3-beta-Hydroxyolean-12-en-28-oic acid|oleonolic acid}}
 +
{{#set: consumed by=RXN-9000}}

Latest revision as of 20:14, 21 March 2018

Metabolite CPD-9459

  • smiles:
    • CC3(C[CH]4(C2(=CC[CH]5(C1(CCC(C([CH]1CCC(C2(CCC(CC3)4C([O-])=O)C)5C)(C)C)O)C))))C
  • common name:
    • oleanolate
  • inchi key:
    • InChIKey=MIJYXULNPSFWEK-GTOFXWBISA-M
  • molecular weight:
    • 455.699
  • Synonym(s):
    • oleanolic acid
    • oleanic acid
    • caryophyllin
    • 3-beta-Hydroxyolean-12-en-28-oic acid
    • oleonolic acid

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"CC3(C[CH]4(C2(=CC[CH]5(C1(CCC(C([CH]1CCC(C2(CCC(CC3)4C([O-])=O)C)5C)(C)C)O)C))))C" cannot be used as a page name in this wiki.