Difference between revisions of "CPD-9451"
From metabolic_network
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-14726 RXN-14726] == * direction: ** LEFT-TO-RIGHT * common name: ** probable_nitrile_hydratase...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-9451 CPD-9451] == * smiles: ** CC(C(C(=O)[O-])=CC(=O)[O-])C * common name: ** 2-isopropylma...") |
||
| (2 intermediate revisions by the same user not shown) | |||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:Metabolite]] |
| − | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-9451 CPD-9451] == |
| − | * | + | * smiles: |
| − | ** | + | ** CC(C(C(=O)[O-])=CC(=O)[O-])C |
* common name: | * common name: | ||
| − | ** | + | ** 2-isopropylmaleate |
| − | * | + | * inchi key: |
| − | ** | + | ** InChIKey=NJMGRJLQRLFQQX-HYXAFXHYSA-L |
| + | * molecular weight: | ||
| + | ** 156.138 | ||
* Synonym(s): | * Synonym(s): | ||
| + | ** β-isopropylmaleate | ||
| + | ** 2-isopropylmaleic acid | ||
| − | == Reaction | + | == Reaction(s) known to consume the compound == |
| − | + | == Reaction(s) known to produce the compound == | |
| − | + | == Reaction(s) of unknown directionality == | |
| − | + | * [[3-ISOPROPYLMALISOM-RXN]] | |
| − | + | * [[RXN-8991]] | |
| − | + | ||
| − | == | + | |
| − | + | ||
| − | * [[ | + | |
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
== External links == | == External links == | ||
| − | + | * PUBCHEM: | |
| − | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=21954611 21954611] | |
| − | {{#set: | + | * HMDB : HMDB12241 |
| − | {{#set: | + | * LIGAND-CPD: |
| − | {{#set: | + | ** [http://www.genome.jp/dbget-bin/www_bget?C02631 C02631] |
| − | {{#set: | + | * CHEMSPIDER: |
| − | {{#set: | + | ** [http://www.chemspider.com/Chemical-Structure.10710392.html 10710392] |
| − | {{#set: | + | * CHEBI: |
| + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=58085 58085] | ||
| + | * BIGG : 2ippm | ||
| + | {{#set: smiles=CC(C(C(=O)[O-])=CC(=O)[O-])C}} | ||
| + | {{#set: common name=2-isopropylmaleate}} | ||
| + | {{#set: inchi key=InChIKey=NJMGRJLQRLFQQX-HYXAFXHYSA-L}} | ||
| + | {{#set: molecular weight=156.138 }} | ||
| + | {{#set: common name=β-isopropylmaleate|2-isopropylmaleic acid}} | ||
| + | {{#set: reversible reaction associated=3-ISOPROPYLMALISOM-RXN|RXN-8991}} | ||
Latest revision as of 21:14, 21 March 2018
Contents
Metabolite CPD-9451
- smiles:
- CC(C(C(=O)[O-])=CC(=O)[O-])C
- common name:
- 2-isopropylmaleate
- inchi key:
- InChIKey=NJMGRJLQRLFQQX-HYXAFXHYSA-L
- molecular weight:
- 156.138
- Synonym(s):
- β-isopropylmaleate
- 2-isopropylmaleic acid
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
- PUBCHEM:
- HMDB : HMDB12241
- LIGAND-CPD:
- CHEMSPIDER:
- CHEBI:
- BIGG : 2ippm
"CC(C(C(=O)[O-])=CC(=O)[O-])C" cannot be used as a page name in this wiki.
