Difference between revisions of "XTP"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD1F-96 CPD1F-96] == * smiles: ** C=C1(C2(O)(CC3(C1)(C([CH]4(C(C)(CCCC(C=O)([CH](CC2)3)4)C([O-...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=XTP XTP] == * smiles: ** C(OP(=O)([O-])OP(=O)([O-])OP(=O)([O-])[O-])C1(OC(C(O)C(O)1)N3(C=NC2(C(...") |
||
(2 intermediate revisions by the same user not shown) | |||
Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
− | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=XTP XTP] == |
* smiles: | * smiles: | ||
− | ** C | + | ** C(OP(=O)([O-])OP(=O)([O-])OP(=O)([O-])[O-])C1(OC(C(O)C(O)1)N3(C=NC2(C(=O)NC(=O)NC=23))) |
− | + | ||
− | + | ||
* common name: | * common name: | ||
− | ** | + | ** XTP |
+ | * inchi key: | ||
+ | ** InChIKey=CAEFEWVYEZABLA-UUOKFMHZSA-J | ||
* molecular weight: | * molecular weight: | ||
− | ** | + | ** 520.136 |
* Synonym(s): | * Synonym(s): | ||
− | ** | + | ** xanthosine 5' triphosphate |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | * [[ | + | * [[RXN0-1603]] |
+ | * [[NTPD]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
== External links == | == External links == | ||
− | |||
− | |||
− | |||
− | |||
* LIGAND-CPD: | * LIGAND-CPD: | ||
− | ** [http://www.genome.jp/dbget-bin/www_bget? | + | ** [http://www.genome.jp/dbget-bin/www_bget?C00700 C00700] |
− | * HMDB : | + | * HMDB : HMDB00293 |
− | {{#set: smiles=C | + | * CHEBI: |
− | {{#set: | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=61314 61314] |
− | {{#set: | + | * BIGG : xtp |
− | {{#set: molecular weight= | + | * PUBCHEM: |
− | {{#set: common name= | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25245622 25245622] |
− | {{#set: consumed by= | + | {{#set: smiles=C(OP(=O)([O-])OP(=O)([O-])OP(=O)([O-])[O-])C1(OC(C(O)C(O)1)N3(C=NC2(C(=O)NC(=O)NC=23)))}} |
− | + | {{#set: common name=XTP}} | |
+ | {{#set: inchi key=InChIKey=CAEFEWVYEZABLA-UUOKFMHZSA-J}} | ||
+ | {{#set: molecular weight=520.136 }} | ||
+ | {{#set: common name=xanthosine 5' triphosphate}} | ||
+ | {{#set: consumed by=RXN0-1603|NTPD}} |
Latest revision as of 21:14, 21 March 2018
Contents
Metabolite XTP
- smiles:
- C(OP(=O)([O-])OP(=O)([O-])OP(=O)([O-])[O-])C1(OC(C(O)C(O)1)N3(C=NC2(C(=O)NC(=O)NC=23)))
- common name:
- XTP
- inchi key:
- InChIKey=CAEFEWVYEZABLA-UUOKFMHZSA-J
- molecular weight:
- 520.136
- Synonym(s):
- xanthosine 5' triphosphate
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"C(OP(=O)([O-])OP(=O)([O-])OP(=O)([O-])[O-])C1(OC(C(O)C(O)1)N3(C=NC2(C(=O)NC(=O)NC=23)))" cannot be used as a page name in this wiki.