Difference between revisions of "CPD-12932"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-9657 RXN-9657] == * direction: ** LEFT-TO-RIGHT * common name: ** crotonyl-[acp] reductase * ec...")
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-12932 CPD-12932] == * smiles: ** CC(C)=CC=CC(C)=CC=CC(C)=CC=CC(C)=CC=CC=C(C)C=CC=C(C)C=CC=C...")
 
(2 intermediate revisions by the same user not shown)
Line 1: Line 1:
−
[[Category:Reaction]]
+
[[Category:Metabolite]]
−
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-9657 RXN-9657] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-12932 CPD-12932] ==
−
* direction:
+
* smiles:
−
** LEFT-TO-RIGHT
+
** CC(C)=CC=CC(C)=CC=CC(C)=CC=CC(C)=CC=CC=C(C)C=CC=C(C)C=CC=C(C)CCC=C(C)C
 
* common name:
 
* common name:
−
** crotonyl-[acp] reductase
+
** all-trans-3,4-didehydrolycopene
−
* ec number:
+
* inchi key:
−
** [http://enzyme.expasy.org/EC/1.3.1.9 EC-1.3.1.9]
+
** InChIKey=OCMSUPSDVXKDFY-FQMRBFJQSA-N
 +
* molecular weight:
 +
** 534.867   
 
* Synonym(s):
 
* Synonym(s):
 +
** 3,4-dehydrolycopene
 +
** 3,4-didehydrolycopene
  
−
== Reaction Formula ==
+
== Reaction(s) known to consume the compound ==
−
* With identifiers:
+
* [[RXN-11999]]
−
** 1 [[Crotonyl-ACPs]][c] '''+''' 1 [[PROTON]][c] '''+''' 1 [[NADH]][c] '''=>''' 1 [[NAD]][c] '''+''' 1 [[Butanoyl-ACPs]][c]
+
== Reaction(s) known to produce the compound ==
−
* With common name(s):
+
== Reaction(s) of unknown directionality ==
−
** 1 a crotonyl-[acp][c] '''+''' 1 H+[c] '''+''' 1 NADH[c] '''=>''' 1 NAD+[c] '''+''' 1 a butyryl-[acp][c]
+
−
 
+
−
== Genes associated with this reaction  ==
+
−
Genes have been associated with this reaction based on different elements listed below.
+
−
* [[Tiso_gene_10778]]
+
−
** [[pantograph]]-[[esiliculosus]]
+
−
== Pathways  ==
+
−
* [[PWY-5971]], palmitate biosynthesis II (bacteria and plants): [http://metacyc.org/META/NEW-IMAGE?object=PWY-5971 PWY-5971]
+
−
** '''31''' reactions found over '''31''' reactions in the full pathway
+
−
== Reconstruction information  ==
+
−
* [[orthology]]:
+
−
** [[pantograph]]:
+
−
*** [[esiliculosus]]
+
 
== External links  ==
 
== External links  ==
−
{{#set: direction=LEFT-TO-RIGHT}}
+
* PUBCHEM:
−
{{#set: common name=crotonyl-[acp] reductase}}
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=16061227 16061227]
−
{{#set: ec number=EC-1.3.1.9}}
+
* CHEMSPIDER:
−
{{#set: gene associated=Tiso_gene_10778}}
+
** [http://www.chemspider.com/Chemical-Structure.17220904.html 17220904]
−
{{#set: in pathway=PWY-5971}}
+
* CHEBI:
−
{{#set: reconstruction category=orthology}}
+
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=62474 62474]
−
{{#set: reconstruction tool=pantograph}}
+
* LIGAND-CPD:
−
{{#set: reconstruction source=esiliculosus}}
+
** [http://www.genome.jp/dbget-bin/www_bget?C15867 C15867]
 +
{{#set: smiles=CC(C)=CC=CC(C)=CC=CC(C)=CC=CC(C)=CC=CC=C(C)C=CC=C(C)C=CC=C(C)CCC=C(C)C}}
 +
{{#set: common name=all-trans-3,4-didehydrolycopene}}
 +
{{#set: inchi key=InChIKey=OCMSUPSDVXKDFY-FQMRBFJQSA-N}}
 +
{{#set: molecular weight=534.867    }}
 +
{{#set: common name=3,4-dehydrolycopene|3,4-didehydrolycopene}}
 +
{{#set: consumed by=RXN-11999}}

Latest revision as of 20:14, 21 March 2018

Metabolite CPD-12932

  • smiles:
    • CC(C)=CC=CC(C)=CC=CC(C)=CC=CC(C)=CC=CC=C(C)C=CC=C(C)C=CC=C(C)CCC=C(C)C
  • common name:
    • all-trans-3,4-didehydrolycopene
  • inchi key:
    • InChIKey=OCMSUPSDVXKDFY-FQMRBFJQSA-N
  • molecular weight:
    • 534.867
  • Synonym(s):
    • 3,4-dehydrolycopene
    • 3,4-didehydrolycopene

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links




Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=CPD-12932&oldid=47109"