Difference between revisions of "CPD-11403"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=O-UREIDOHOMOSERINE O-UREIDOHOMOSERINE] == * smiles: ** C(CC(C(=O)[O-])[N+])ONC(N)=O * inchi key...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-11403 CPD-11403] == * smiles: ** C(=O)([O-])CC1(C=C(I)C(=C(I)C=1)OC2(=CC(I)=C(O)C(I)=C2)) *...") |
||
| (2 intermediate revisions by the same user not shown) | |||
| Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
| − | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-11403 CPD-11403] == |
* smiles: | * smiles: | ||
| − | ** | + | ** C(=O)([O-])CC1(C=C(I)C(=C(I)C=1)OC2(=CC(I)=C(O)C(I)=C2)) |
| − | + | ||
| − | + | ||
* common name: | * common name: | ||
| − | ** | + | ** tetraiodothyroacetate |
| + | * inchi key: | ||
| + | ** InChIKey=PPJYSSNKSXAVDB-UHFFFAOYSA-M | ||
* molecular weight: | * molecular weight: | ||
| − | ** | + | ** 746.825 |
* Synonym(s): | * Synonym(s): | ||
| + | ** Tetrac | ||
| + | ** tetraiodothyroacetic acid | ||
| + | ** TA4 | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[RXN- | + | * [[RXN-10616]] |
| + | * [[RXN-10617]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
== External links == | == External links == | ||
* PUBCHEM: | * PUBCHEM: | ||
| − | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid= | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=44237272 44237272] |
| − | + | {{#set: smiles=C(=O)([O-])CC1(C=C(I)C(=C(I)C=1)OC2(=CC(I)=C(O)C(I)=C2))}} | |
| − | {{#set: smiles= | + | {{#set: common name=tetraiodothyroacetate}} |
| − | {{#set: inchi key=InChIKey= | + | {{#set: inchi key=InChIKey=PPJYSSNKSXAVDB-UHFFFAOYSA-M}} |
| − | {{#set: | + | {{#set: molecular weight=746.825 }} |
| − | {{#set: | + | {{#set: common name=Tetrac|tetraiodothyroacetic acid|TA4}} |
| − | {{#set: consumed by=RXN- | + | {{#set: consumed by=RXN-10616|RXN-10617}} |
Latest revision as of 20:14, 21 March 2018
Contents
Metabolite CPD-11403
- smiles:
- C(=O)([O-])CC1(C=C(I)C(=C(I)C=1)OC2(=CC(I)=C(O)C(I)=C2))
- common name:
- tetraiodothyroacetate
- inchi key:
- InChIKey=PPJYSSNKSXAVDB-UHFFFAOYSA-M
- molecular weight:
- 746.825
- Synonym(s):
- Tetrac
- tetraiodothyroacetic acid
- TA4
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
- PUBCHEM:
"C(=O)([O-])CC1(C=C(I)C(=C(I)C=1)OC2(=CC(I)=C(O)C(I)=C2))" cannot be used as a page name in this wiki.
