Difference between revisions of "Tiso gene 18785"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD0-1812 CPD0-1812] == * smiles: ** CCCCCCCCC=CCCCCCCCC(=O)OC(CO)CO * inchi key: ** InChIKey=U...") |
(Created page with "Category:Gene == Gene Tiso_gene_18785 == * right end position: ** 2783 * transcription direction: ** POSITIVE * left end position: ** 27 * centisome position: ** 0.964975...") |
||
(2 intermediate revisions by the same user not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Gene]] |
− | == | + | == Gene Tiso_gene_18785 == |
− | * | + | * right end position: |
− | ** | + | ** 2783 |
− | * | + | * transcription direction: |
− | ** | + | ** POSITIVE |
− | * | + | * left end position: |
− | ** | + | ** 27 |
− | * | + | * centisome position: |
− | ** | + | ** 0.964975 |
* Synonym(s): | * Synonym(s): | ||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | == | + | == Reactions associated == |
− | * [[RXN- | + | * Reaction: [[RXN-3701]] |
− | * [[ | + | ** Source: [[annotation-in-silico_annotation]] |
− | * [[ | + | *** Assignment: ec-number |
− | == | + | ** Source: [[orthology-esiliculosus]] |
− | + | == Pathways associated == | |
== External links == | == External links == | ||
− | + | {{#set: right end position=2783}} | |
− | + | {{#set: transcription direction=POSITIVE}} | |
− | + | {{#set: left end position=27}} | |
− | + | {{#set: centisome position=0.964975 }} | |
− | + | {{#set: reaction associated=RXN-3701}} | |
− | + | ||
− | + | ||
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | + |
Latest revision as of 20:14, 21 March 2018
Gene Tiso_gene_18785
- right end position:
- 2783
- transcription direction:
- POSITIVE
- left end position:
- 27
- centisome position:
- 0.964975
- Synonym(s):
Reactions associated
- Reaction: RXN-3701
- Source: annotation-in-silico_annotation
- Assignment: ec-number
- Source: orthology-esiliculosus
- Source: annotation-in-silico_annotation