Difference between revisions of "CPD-17815"
From metabolic_network
(Created page with "Category:Gene == Gene Tiso_gene_10094 == * left end position: ** 1299 * transcription direction: ** POSITIVE * right end position: ** 3101 * centisome position: ** 14.7212...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-17815 CPD-17815] == * smiles: ** CCCCC=CCCCCCCCC(=O)CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=...") |
||
| (2 intermediate revisions by the same user not shown) | |||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:Metabolite]] |
| − | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-17815 CPD-17815] == |
| − | * | + | * smiles: |
| − | ** | + | ** CCCCC=CCCCCCCCC(=O)CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-] |
| − | * | + | * common name: |
| − | ** | + | ** (11Z)-3-oxo-hexadecenoyl-CoA |
| − | * | + | * inchi key: |
| − | ** | + | ** InChIKey=LGTVDWICXIBIOI-UBPKJMQESA-J |
| − | * | + | * molecular weight: |
| − | ** | + | ** 1013.883 |
* Synonym(s): | * Synonym(s): | ||
| − | == | + | == Reaction(s) known to consume the compound == |
| − | * [[ | + | * [[RXN-16561]] |
| − | + | == Reaction(s) known to produce the compound == | |
| − | + | * [[RXN-16559]] | |
| − | + | == Reaction(s) of unknown directionality == | |
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | == | + | |
| − | + | ||
== External links == | == External links == | ||
| − | {{#set: | + | * PUBCHEM: |
| − | {{#set: | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=86289728 86289728] |
| − | {{#set: | + | * CHEBI: |
| − | {{#set: | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=79021 79021] |
| − | {{#set: | + | {{#set: smiles=CCCCC=CCCCCCCCC(=O)CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]}} |
| − | {{#set: | + | {{#set: common name=(11Z)-3-oxo-hexadecenoyl-CoA}} |
| + | {{#set: inchi key=InChIKey=LGTVDWICXIBIOI-UBPKJMQESA-J}} | ||
| + | {{#set: molecular weight=1013.883 }} | ||
| + | {{#set: consumed by=RXN-16561}} | ||
| + | {{#set: produced by=RXN-16559}} | ||
Latest revision as of 21:14, 21 March 2018
Contents
Metabolite CPD-17815
- smiles:
- CCCCC=CCCCCCCCC(=O)CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]
- common name:
- (11Z)-3-oxo-hexadecenoyl-CoA
- inchi key:
- InChIKey=LGTVDWICXIBIOI-UBPKJMQESA-J
- molecular weight:
- 1013.883
- Synonym(s):
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"CCCCC=CCCCCCCCC(=O)CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-" cannot be used as a page name in this wiki.
