Difference between revisions of "Tiso gene 11824"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-696 CPD-696] == * smiles: ** CC(C)C(=C)CCC(C)[CH]3(CCC4(C)([CH]1(CC[CH]5(C(C)(C)C(O)CCC2(CC...")
(Created page with "Category:Gene == Gene Tiso_gene_11824 == * right end position: ** 6117 * transcription direction: ** NEGATIVE * left end position: ** 3821 * centisome position: ** 50.9942...")
 
(2 intermediate revisions by the same user not shown)
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Gene]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-696 CPD-696] ==
+
== Gene Tiso_gene_11824 ==
−
* smiles:
+
* right end position:
−
** CC(C)C(=C)CCC(C)[CH]3(CCC4(C)([CH]1(CC[CH]5(C(C)(C)C(O)CCC2(CC12CCC(C)34)5))))
+
** 6117
−
* inchi key:
+
* transcription direction:
−
** InChIKey=BDHQMRXFDYJGII-XPNRYQHYSA-N
+
** NEGATIVE
−
* common name:
+
* left end position:
−
** 24-methylenecycloartanol
+
** 3821
−
* molecular weight:
+
* centisome position:
−
** 440.751    
+
** 50.99426    
 
* Synonym(s):
 
* Synonym(s):
−
** 24(28)-methylenecycloartanol
 
  
−
== Reaction(s) known to consume the compound ==
+
== Reactions associated ==
−
== Reaction(s) known to produce the compound ==
+
* Reaction: [[DIACYLGLYCEROL-O-ACYLTRANSFERASE-RXN]]
−
* [[RXN-4021]]
+
** Source: [[annotation-in-silico_annotation]]
−
== Reaction(s) of unknown directionality ==
+
*** Assignment: ec-number
 +
== Pathways associated ==
 +
* [[TRIGLSYN-PWY]]
 
== External links  ==
 
== External links  ==
−
* PUBCHEM:
+
{{#set: right end position=6117}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=21157981 21157981]
+
{{#set: transcription direction=NEGATIVE}}
−
* LIGAND-CPD:
+
{{#set: left end position=3821}}
−
** [http://www.genome.jp/dbget-bin/www_bget?C08830 C08830]
+
{{#set: centisome position=50.99426   }}
−
{{#set: smiles=CC(C)C(=C)CCC(C)[CH]3(CCC4(C)([CH]1(CC[CH]5(C(C)(C)C(O)CCC2(CC12CCC(C)34)5))))}}
+
{{#set: reaction associated=DIACYLGLYCEROL-O-ACYLTRANSFERASE-RXN}}
−
{{#set: inchi key=InChIKey=BDHQMRXFDYJGII-XPNRYQHYSA-N}}
+
{{#set: pathway associated=TRIGLSYN-PWY}}
−
{{#set: common name=24-methylenecycloartanol}}
+
−
{{#set: molecular weight=440.751   }}
+
−
{{#set: common name=24(28)-methylenecycloartanol}}
+
−
{{#set: produced by=RXN-4021}}
+

Latest revision as of 20:15, 21 March 2018

Gene Tiso_gene_11824

  • right end position:
    • 6117
  • transcription direction:
    • NEGATIVE
  • left end position:
    • 3821
  • centisome position:
    • 50.99426
  • Synonym(s):

Reactions associated

Pathways associated

External links

Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=Tiso_gene_11824&oldid=47185"