Difference between revisions of "CPD-11402"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN1F-20 RXN1F-20] == * direction: ** LEFT-TO-RIGHT * common name: ** Magnesium chelatase, H subuni...")
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-11402 CPD-11402] == * smiles: ** C([O-])(=O)C1(OC(C(O)C(O)C(O)1)OC(=O)C(N)CC2(=CC(I)=C(C(I)...")
 
(2 intermediate revisions by the same user not shown)
Line 1: Line 1:
−
[[Category:Reaction]]
+
[[Category:Metabolite]]
−
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN1F-20 RXN1F-20] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-11402 CPD-11402] ==
−
* direction:
+
* smiles:
−
** LEFT-TO-RIGHT
+
** C([O-])(=O)C1(OC(C(O)C(O)C(O)1)OC(=O)C(N)CC2(=CC(I)=C(C(I)=C2)OC3(=CC(I)=C(O)C=C3)))
 
* common name:
 
* common name:
−
** Magnesium chelatase, H subunit
+
** 3,5,3'-triiodo-L-thyronine acyl β-D-glucuronide
−
** h_subunit_of_mg_chelatase
+
* inchi key:
−
** magnesium_chelatase
+
** InChIKey=LQMBVWCQWFEPFK-DKBYMCRTSA-M
−
* ec number:
+
* molecular weight:
−
** [http://enzyme.expasy.org/EC/6.6.1.1 EC-6.6.1.1]
+
** 826.095   
 
* Synonym(s):
 
* Synonym(s):
 +
** 3,5,3'-triiodothyronine acyl β-D-glucuronide
  
−
== Reaction Formula ==
+
== Reaction(s) known to consume the compound ==
−
* With identifiers:
+
== Reaction(s) known to produce the compound ==
−
** 1 [[MG+2]][c] '''+''' 1 [[WATER]][c] '''+''' 1 [[ATP]][c] '''+''' 1 [[PROTOPORPHYRIN_IX]][c] '''=>''' 1 [[Pi]][c] '''+''' 3 [[PROTON]][c] '''+''' 1 [[ADP]][c] '''+''' 1 [[MG-PROTOPORPHYRIN]][c]
+
* [[RXN-10609]]
−
* With common name(s):
+
== Reaction(s) of unknown directionality ==
−
** 1 Mg2+[c] '''+''' 1 H2O[c] '''+''' 1 ATP[c] '''+''' 1 protoporphyrin IX[c] '''=>''' 1 phosphate[c] '''+''' 3 H+[c] '''+''' 1 ADP[c] '''+''' 1 Mg-protoporphyrin[c]
+
−
 
+
−
== Genes associated with this reaction  ==
+
−
Genes have been associated with this reaction based on different elements listed below.
+
−
* [[Tiso_gene_5993]]
+
−
** IN-SILICO_ANNOTATION
+
−
***AUTOMATED-NAME-MATCH
+
−
** [[pantograph]]-[[esiliculosus]]
+
−
* [[Tiso_gene_9870]]
+
−
** IN-SILICO_ANNOTATION
+
−
***EC-NUMBER
+
−
** EXPERIMENTAL_ANNOTATION
+
−
***EC-NUMBER
+
−
** [[pantograph]]-[[athaliana]]
+
−
** [[pantograph]]-[[esiliculosus]]
+
−
* [[Tiso_gene_11960]]
+
−
** IN-SILICO_ANNOTATION
+
−
***EC-NUMBER
+
−
** EXPERIMENTAL_ANNOTATION
+
−
***EC-NUMBER
+
−
** [[pantograph]]-[[athaliana]]
+
−
** [[pantograph]]-[[esiliculosus]]
+
−
== Pathways  ==
+
−
* [[PWY-5531]], 3,8-divinyl-chlorophyllide a biosynthesis II (anaerobic): [http://metacyc.org/META/NEW-IMAGE?object=PWY-5531 PWY-5531]
+
−
** '''4''' reactions found over '''9''' reactions in the full pathway
+
−
* [[CHLOROPHYLL-SYN]], 3,8-divinyl-chlorophyllide a biosynthesis I (aerobic, light-dependent): [http://metacyc.org/META/NEW-IMAGE?object=CHLOROPHYLL-SYN CHLOROPHYLL-SYN]
+
−
** '''9''' reactions found over '''9''' reactions in the full pathway
+
−
* [[PWY-7159]], 3,8-divinyl-chlorophyllide a biosynthesis III (aerobic, light independent): [http://metacyc.org/META/NEW-IMAGE?object=PWY-7159 PWY-7159]
+
−
** '''8''' reactions found over '''9''' reactions in the full pathway
+
−
== Reconstruction information  ==
+
−
* [[orthology]]:
+
−
** [[pantograph]]:
+
−
*** [[athaliana]]
+
−
*** [[esiliculosus]]
+
−
* [[manual]]:
+
−
** [[primary_network]]
+
−
* [[annotation]]:
+
−
** [[pathwaytools]]:
+
−
*** [[experimental_annotation]]
+
−
*** [[in-silico_annotation]]
+
 
== External links  ==
 
== External links  ==
−
* RHEA:
+
* PUBCHEM:
−
** [http://www.ebi.ac.uk/rhea/reaction.xhtml?id=13961 13961]
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=90659330 90659330]
−
* LIGAND-RXN:
+
{{#set: smiles=C([O-])(=O)C1(OC(C(O)C(O)C(O)1)OC(=O)C(N)CC2(=CC(I)=C(C(I)=C2)OC3(=CC(I)=C(O)C=C3)))}}
−
** [http://www.genome.jp/dbget-bin/www_bget?R03877 R03877]
+
{{#set: common name=3,5,3'-triiodo-L-thyronine acyl β-D-glucuronide}}
−
{{#set: direction=LEFT-TO-RIGHT}}
+
{{#set: inchi key=InChIKey=LQMBVWCQWFEPFK-DKBYMCRTSA-M}}
−
{{#set: common name=Magnesium chelatase, H subunit}}
+
{{#set: molecular weight=826.095    }}
−
{{#set: common name=h_subunit_of_mg_chelatase}}
+
{{#set: common name=3,5,3'-triiodothyronine acyl β-D-glucuronide}}
−
{{#set: common name=magnesium_chelatase}}
+
{{#set: produced by=RXN-10609}}
−
{{#set: ec number=EC-6.6.1.1}}
+
−
{{#set: gene associated=Tiso_gene_5993|Tiso_gene_9870|Tiso_gene_11960}}
+
−
{{#set: in pathway=PWY-5531|CHLOROPHYLL-SYN|PWY-7159}}
+
−
{{#set: reconstruction category=orthology}}
+
−
{{#set: reconstruction tool=pantograph}}
+
−
{{#set: reconstruction source=athaliana|esiliculosus}}
+
−
{{#set: reconstruction category=manual}}
+
−
{{#set: reconstruction source=primary_network}}
+
−
{{#set: reconstruction category=annotation}}
+
−
{{#set: reconstruction tool=pathwaytools}}
+
−
{{#set: reconstruction source=experimental_annotation|in-silico_annotation}}
+

Latest revision as of 20:15, 21 March 2018

Metabolite CPD-11402

  • smiles:
    • C([O-])(=O)C1(OC(C(O)C(O)C(O)1)OC(=O)C(N)CC2(=CC(I)=C(C(I)=C2)OC3(=CC(I)=C(O)C=C3)))
  • common name:
    • 3,5,3'-triiodo-L-thyronine acyl β-D-glucuronide
  • inchi key:
    • InChIKey=LQMBVWCQWFEPFK-DKBYMCRTSA-M
  • molecular weight:
    • 826.095
  • Synonym(s):
    • 3,5,3'-triiodothyronine acyl β-D-glucuronide

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"C([O-])(=O)C1(OC(C(O)C(O)C(O)1)OC(=O)C(N)CC2(=CC(I)=C(C(I)=C2)OC3(=CC(I)=C(O)C=C3)))" cannot be used as a page name in this wiki.



Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=CPD-11402&oldid=47210"