Difference between revisions of "CPD1F-137"
From metabolic_network
(Created page with "Category:Gene == Gene Tiso_gene_11824 == * left end position: ** 3821 * transcription direction: ** NEGATIVE * right end position: ** 6117 * centisome position: ** 50.9942...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD1F-137 CPD1F-137] == * smiles: ** C=C1(C3(CC4(C1)(C([CH]5(C2(C(=O)OC(CCC(O)2)([CH](CC3)4)5)(...") |
||
(2 intermediate revisions by the same user not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Metabolite]] |
− | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD1F-137 CPD1F-137] == |
− | * | + | * smiles: |
− | ** | + | ** C=C1(C3(CC4(C1)(C([CH]5(C2(C(=O)OC(CCC(O)2)([CH](CC3)4)5)(C)))C([O-])=O))) |
− | * | + | * common name: |
− | ** | + | ** gibberellin A4 |
− | * | + | * inchi key: |
− | ** | + | ** InChIKey=RSQSQJNRHICNNH-UKJRIFTCSA-M |
− | * | + | * molecular weight: |
− | ** | + | ** 331.388 |
* Synonym(s): | * Synonym(s): | ||
+ | ** GA4 | ||
− | == | + | == Reaction(s) known to consume the compound == |
− | * [[ | + | * [[RXN-6550]] |
− | + | == Reaction(s) known to produce the compound == | |
− | + | * [[RXN1F-165]] | |
− | == | + | == Reaction(s) of unknown directionality == |
− | * [[ | + | |
== External links == | == External links == | ||
− | {{#set: | + | * LIPID_MAPS : LMPR0104170021 |
− | {{#set: | + | * DRUGBANK : DB07815 |
− | {{#set: | + | * PUBCHEM: |
− | {{#set: | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25245706 25245706] |
− | {{#set: | + | * LIGAND-CPD: |
− | {{#set: | + | ** [http://www.genome.jp/dbget-bin/www_bget?C11864 C11864] |
+ | * CHEBI: | ||
+ | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=32902 32902] | ||
+ | * METABOLIGHTS : MTBLC32902 | ||
+ | {{#set: smiles=C=C1(C3(CC4(C1)(C([CH]5(C2(C(=O)OC(CCC(O)2)([CH](CC3)4)5)(C)))C([O-])=O)))}} | ||
+ | {{#set: common name=gibberellin A4}} | ||
+ | {{#set: inchi key=InChIKey=RSQSQJNRHICNNH-UKJRIFTCSA-M}} | ||
+ | {{#set: molecular weight=331.388 }} | ||
+ | {{#set: common name=GA4}} | ||
+ | {{#set: consumed by=RXN-6550}} | ||
+ | {{#set: produced by=RXN1F-165}} |
Latest revision as of 20:15, 21 March 2018
Contents
Metabolite CPD1F-137
- smiles:
- C=C1(C3(CC4(C1)(C([CH]5(C2(C(=O)OC(CCC(O)2)([CH](CC3)4)5)(C)))C([O-])=O)))
- common name:
- gibberellin A4
- inchi key:
- InChIKey=RSQSQJNRHICNNH-UKJRIFTCSA-M
- molecular weight:
- 331.388
- Synonym(s):
- GA4
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
- LIPID_MAPS : LMPR0104170021
- DRUGBANK : DB07815
- PUBCHEM:
- LIGAND-CPD:
- CHEBI:
- METABOLIGHTS : MTBLC32902
"C=C1(C3(CC4(C1)(C([CH]5(C2(C(=O)OC(CCC(O)2)([CH](CC3)4)5)(C)))C([O-])=O)))" cannot be used as a page name in this wiki.