Difference between revisions of "CPD-4568"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-10089 RXN-10089] == * direction: ** LEFT-TO-RIGHT * common name: ** imidazole acetaldehyde redu...")
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-4568 CPD-4568] == * smiles: ** CC(C)=CCCC([CH]1(C2(C)(C(CO)(CC1)C4(=C(CC2)C3([CH](C(C)(C)C(...")
 
(2 intermediate revisions by the same user not shown)
Line 1: Line 1:
−
[[Category:Reaction]]
+
[[Category:Metabolite]]
−
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-10089 RXN-10089] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-4568 CPD-4568] ==
−
* direction:
+
* smiles:
−
** LEFT-TO-RIGHT
+
** CC(C)=CCCC([CH]1(C2(C)(C(CO)(CC1)C4(=C(CC2)C3([CH](C(C)(C)C(O)CC3)CC4)(C)))))C
 
* common name:
 
* common name:
−
** imidazole acetaldehyde reductase
+
** 14-hydroxylanosterol
−
* ec number:
+
* inchi key:
−
** [http://enzyme.expasy.org/EC/1.2.1.3 EC-1.2.1.3]
+
** InChIKey=DWVYYKFZEDMMPU-PUXRVUTHSA-N
 +
* molecular weight:
 +
** 442.724   
 
* Synonym(s):
 
* Synonym(s):
 +
** 4,4-dimethyl-14α-hydroxymethyl-5α-cholesta-8,24-dien-3β-ol
  
−
== Reaction Formula ==
+
== Reaction(s) known to consume the compound ==
−
* With identifiers:
+
* [[RXN66-304]]
−
** 1 [[WATER]][c] '''+''' 1 [[NAD]][c] '''+''' 1 [[IMIDAZOLE_ACETALDEHYDE]][c] '''=>''' 1 [[4-IMIDAZOLEACETATE]][c] '''+''' 1 [[NADH]][c] '''+''' 2 [[PROTON]][c]
+
== Reaction(s) known to produce the compound ==
−
* With common name(s):
+
* [[RXN66-303]]
−
** 1 H2O[c] '''+''' 1 NAD+[c] '''+''' 1 imidazole acetaldehyde[c] '''=>''' 1 4-imidazoleacetate[c] '''+''' 1 NADH[c] '''+''' 2 H+[c]
+
== Reaction(s) of unknown directionality ==
−
 
+
−
== Genes associated with this reaction  ==
+
−
Genes have been associated with this reaction based on different elements listed below.
+
−
* [[Tiso_gene_7322]]
+
−
** [[pantograph]]-[[athaliana]]
+
−
** [[pantograph]]-[[esiliculosus]]
+
−
* [[Tiso_gene_3513]]
+
−
** [[pantograph]]-[[athaliana]]
+
−
== Pathways  ==
+
−
* [[PWY-6181]], histamine degradation: [http://metacyc.org/META/NEW-IMAGE?object=PWY-6181 PWY-6181]
+
−
** '''2''' reactions found over '''3''' reactions in the full pathway
+
−
== Reconstruction information  ==
+
−
* [[orthology]]:
+
−
** [[pantograph]]:
+
−
*** [[athaliana]]
+
−
*** [[esiliculosus]]
+
 
== External links  ==
 
== External links  ==
−
* RHEA:
+
* PUBCHEM:
−
** [http://www.ebi.ac.uk/rhea/reaction.xhtml?id=31059 31059]
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=22298935 22298935]
−
* LIGAND-RXN:
+
{{#set: smiles=CC(C)=CCCC([CH]1(C2(C)(C(CO)(CC1)C4(=C(CC2)C3([CH](C(C)(C)C(O)CC3)CC4)(C)))))C}}
−
** [http://www.genome.jp/dbget-bin/www_bget?R04065 R04065]
+
{{#set: common name=14-hydroxylanosterol}}
−
{{#set: direction=LEFT-TO-RIGHT}}
+
{{#set: inchi key=InChIKey=DWVYYKFZEDMMPU-PUXRVUTHSA-N}}
−
{{#set: common name=imidazole acetaldehyde reductase}}
+
{{#set: molecular weight=442.724    }}
−
{{#set: ec number=EC-1.2.1.3}}
+
{{#set: common name=4,4-dimethyl-14α-hydroxymethyl-5α-cholesta-8,24-dien-3β-ol}}
−
{{#set: gene associated=Tiso_gene_7322|Tiso_gene_3513}}
+
{{#set: consumed by=RXN66-304}}
−
{{#set: in pathway=PWY-6181}}
+
{{#set: produced by=RXN66-303}}
−
{{#set: reconstruction category=orthology}}
+
−
{{#set: reconstruction tool=pantograph}}
+
−
{{#set: reconstruction source=athaliana|esiliculosus}}
+

Latest revision as of 20:15, 21 March 2018

Metabolite CPD-4568

  • smiles:
    • CC(C)=CCCC([CH]1(C2(C)(C(CO)(CC1)C4(=C(CC2)C3([CH](C(C)(C)C(O)CC3)CC4)(C)))))C
  • common name:
    • 14-hydroxylanosterol
  • inchi key:
    • InChIKey=DWVYYKFZEDMMPU-PUXRVUTHSA-N
  • molecular weight:
    • 442.724
  • Synonym(s):
    • 4,4-dimethyl-14α-hydroxymethyl-5α-cholesta-8,24-dien-3β-ol

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"CC(C)=CCCC([CH]1(C2(C)(C(CO)(CC1)C4(=C(CC2)C3([CH](C(C)(C)C(O)CC3)CC4)(C)))))C" cannot be used as a page name in this wiki.




Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=CPD-4568&oldid=47244"