Difference between revisions of "RXN-17609"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-13376 CPD-13376] == * smiles: ** C8(C(C(C(C(OCC7(OC(OC2(C(O)C(O)C(OC(COC1(C(C(C(CO1)O)O)O))...")
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-17609 RXN-17609] == * direction: ** LEFT-TO-RIGHT * common name: ** probable_nitrile_hydratase...")
 
(2 intermediate revisions by the same user not shown)
Line 1: Line 1:
[[Category:Metabolite]]
+
[[Category:Reaction]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-13376 CPD-13376] ==
+
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-17609 RXN-17609] ==
* smiles:
+
* direction:
** C8(C(C(C(C(OCC7(OC(OC2(C(O)C(O)C(OC(COC1(C(C(C(CO1)O)O)O))2)OC5(C(O)C(O)C(OC(COC3(C(C(C(CO3)O)O)OC4(C(C(C(C(O4)CO)O)O)O)))5)OC6(C(O)C(O)C(O)OC(CO)6))))C(O)C(O)C(O)7))O8)O)O)O)
+
** LEFT-TO-RIGHT
* inchi key:
+
** InChIKey=UJNIQUVNFJIFMG-IKGYADNMSA-N
+
 
* common name:
 
* common name:
** XXLG xyloglucan oligosaccharide
+
** probable_nitrile_hydratase
* molecular weight:
+
* ec number:
** 1225.073   
+
** [http://enzyme.expasy.org/EC/4.2.1.84 EC-4.2.1.84]
 
* Synonym(s):
 
* Synonym(s):
  
== Reaction(s) known to consume the compound ==
+
== Reaction Formula ==
* [[RXN-12398]]
+
* With identifiers:
== Reaction(s) known to produce the compound ==
+
** 1 [[WATER]][c] '''+''' 1 [[2-HYDROXY-2-METHYLPROPANENITRILE]][c] '''=>''' 1 [[CPD-19042]][c]
== Reaction(s) of unknown directionality ==
+
* With common name(s):
 +
** 1 H2O[c] '''+''' 1 2-hydroxy-2-methylpropanenitrile[c] '''=>''' 1 2-hydroxyisobutyramide[c]
 +
 
 +
== Genes associated with this reaction  ==
 +
Genes have been associated with this reaction based on different elements listed below.
 +
* Gene: [[Tiso_gene_4032]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Assignment: EC-NUMBER
 +
== Pathways  ==
 +
== Reconstruction information  ==
 +
* Category: [[annotation]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Tool: [[pathwaytools]]
 
== External links  ==
 
== External links  ==
* PUBCHEM:
+
{{#set: direction=LEFT-TO-RIGHT}}
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=52940123 52940123]
+
{{#set: common name=probable_nitrile_hydratase}}
{{#set: smiles=C8(C(C(C(C(OCC7(OC(OC2(C(O)C(O)C(OC(COC1(C(C(C(CO1)O)O)O))2)OC5(C(O)C(O)C(OC(COC3(C(C(C(CO3)O)O)OC4(C(C(C(C(O4)CO)O)O)O)))5)OC6(C(O)C(O)C(O)OC(CO)6))))C(O)C(O)C(O)7))O8)O)O)O)}}
+
{{#set: ec number=EC-4.2.1.84}}
{{#set: inchi key=InChIKey=UJNIQUVNFJIFMG-IKGYADNMSA-N}}
+
{{#set: gene associated=Tiso_gene_4032}}
{{#set: common name=XXLG xyloglucan oligosaccharide}}
+
{{#set: in pathway=}}
{{#set: molecular weight=1225.073    }}
+
{{#set: reconstruction category=annotation}}
{{#set: consumed by=RXN-12398}}
+
{{#set: reconstruction source=annotation-in-silico_annotation}}
 +
{{#set: reconstruction tool=pathwaytools}}

Latest revision as of 20:15, 21 March 2018

Reaction RXN-17609

  • direction:
    • LEFT-TO-RIGHT
  • common name:
    • probable_nitrile_hydratase
  • ec number:
  • Synonym(s):

Reaction Formula

Genes associated with this reaction

Genes have been associated with this reaction based on different elements listed below.

Pathways

Reconstruction information

External links