Difference between revisions of "CPD-15924"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Gene == Gene Tiso_gene_1404 == * left end position: ** 8802 * transcription direction: ** POSITIVE * right end position: ** 10758 * centisome position: ** 36.9195...")
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-15924 CPD-15924] == * smiles: ** CCCCCCCCC=CCCCCCCCC(=O)OCC(COP([O-])([O-])=O)=O * common n...")
 
(2 intermediate revisions by the same user not shown)
Line 1: Line 1:
[[Category:Gene]]
+
[[Category:Metabolite]]
== Gene Tiso_gene_1404 ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-15924 CPD-15924] ==
* left end position:
+
* smiles:
** 8802
+
** CCCCCCCCC=CCCCCCCCC(=O)OCC(COP([O-])([O-])=O)=O
* transcription direction:
+
* common name:
** POSITIVE
+
** 1-oleoyl-2-lyso-glycerone phosphate
* right end position:
+
* inchi key:
** 10758
+
** InChIKey=YZKFNNQAEBNCEN-KTKRTIGZSA-L
* centisome position:
+
* molecular weight:
** 36.91959    
+
** 432.493    
 
* Synonym(s):
 
* Synonym(s):
 +
** 1-oleoyl-2-lyso-dihydroxyacetone phosphate
  
== Reactions associated ==
+
== Reaction(s) known to consume the compound ==
* [[PEPTIDYLPROLYL-ISOMERASE-RXN]]
+
* [[RXN-15046]]
** in-silico_annotation
+
== Reaction(s) known to produce the compound ==
***automated-name-match
+
* [[RXN-15044]]
== Pathways associated ==
+
== Reaction(s) of unknown directionality ==
 
== External links  ==
 
== External links  ==
{{#set: left end position=8802}}
+
* PUBCHEM:
{{#set: transcription direction=POSITIVE}}
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=86289257 86289257]
{{#set: right end position=10758}}
+
* CHEBI:
{{#set: centisome position=36.91959   }}
+
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=77492 77492]
{{#set: reaction associated=PEPTIDYLPROLYL-ISOMERASE-RXN}}
+
{{#set: smiles=CCCCCCCCC=CCCCCCCCC(=O)OCC(COP([O-])([O-])=O)=O}}
 +
{{#set: common name=1-oleoyl-2-lyso-glycerone phosphate}}
 +
{{#set: inchi key=InChIKey=YZKFNNQAEBNCEN-KTKRTIGZSA-L}}
 +
{{#set: molecular weight=432.493   }}
 +
{{#set: common name=1-oleoyl-2-lyso-dihydroxyacetone phosphate}}
 +
{{#set: consumed by=RXN-15046}}
 +
{{#set: produced by=RXN-15044}}

Latest revision as of 21:16, 21 March 2018

Metabolite CPD-15924

  • smiles:
    • CCCCCCCCC=CCCCCCCCC(=O)OCC(COP([O-])([O-])=O)=O
  • common name:
    • 1-oleoyl-2-lyso-glycerone phosphate
  • inchi key:
    • InChIKey=YZKFNNQAEBNCEN-KTKRTIGZSA-L
  • molecular weight:
    • 432.493
  • Synonym(s):
    • 1-oleoyl-2-lyso-dihydroxyacetone phosphate

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"CCCCCCCCC=CCCCCCCCC(=O)OCC(COP([O-])([O-])=O)=O" cannot be used as a page name in this wiki.