Difference between revisions of "RXN-12244"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=THREO-DS-ISO-CITRATE THREO-DS-ISO-CITRATE] == * smiles: ** C(=O)(C(CC([O-])=O)C(O)C([O-])=O)[O-...")
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-12244 RXN-12244] == * direction: ** LEFT-TO-RIGHT * common name: ** 15-cis-phytoene desaturase...")
 
(2 intermediate revisions by the same user not shown)
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Reaction]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=THREO-DS-ISO-CITRATE THREO-DS-ISO-CITRATE] ==
+
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-12244 RXN-12244] ==
−
* smiles:
+
* direction:
−
** C(=O)(C(CC([O-])=O)C(O)C([O-])=O)[O-]
+
** LEFT-TO-RIGHT
−
* inchi key:
+
−
** InChIKey=ODBLHEXUDAPZAU-ZAFYKAAXSA-K
+
 
* common name:
 
* common name:
−
** D-threo-isocitrate
+
** 15-cis-phytoene desaturase
−
* molecular weight:
+
−
** 189.101   
+
 
* Synonym(s):
 
* Synonym(s):
−
** D-threo-isocitrate
+
** phytoene desaturase (ambiguous)
−
** (1R, 2S)-1-hydroxypropane-1,2,3-tricarboxylate
+
** PDS
−
** D-threo-isocitric acid
+
** plant-type phytoene desaturase
−
** isocitric acid
+
−
** isocitrate
+
−
** threo-Ds-isocitrate
+
−
** I-CIT
+
−
** D-isocitrate
+
  
−
== Reaction(s) known to consume the compound ==
+
== Reaction Formula ==
−
== Reaction(s) known to produce the compound ==
+
* With identifiers:
−
== Reaction(s) of unknown directionality ==
+
** 1 [[PLASTOQUINONE]][c] '''+''' 1 [[CPD-13171]][c] '''=>''' 1 [[Plastoquinols]][c] '''+''' 1 [[CPD-7535]][c]
−
* [[ACONITATEHYDR-RXN]]
+
* With common name(s):
−
* [[ISOCITDEH-RXN]]
+
** 1 a plastoquinone[c] '''+''' 1 15,9'-di-cis-phytofluene[c] '''=>''' 1 a plastoquinol[c] '''+''' 1 9,15,9'-tri-cis-ζ-carotene[c]
−
* [[RXN-14047]]
+
 
−
* [[ISOCIT-CLEAV-RXN]]
+
== Genes associated with this reaction  ==
−
* [[RXN-9951]]
+
== Pathways  ==
 +
* [[PWY-6475]], trans-lycopene biosynthesis II (plants): [http://metacyc.org/META/NEW-IMAGE?object=PWY-6475 PWY-6475]
 +
** '''8''' reactions found over '''8''' reactions in the full pathway
 +
== Reconstruction information  ==
 +
* Category: [[manual]]
 +
** Source: [[manual-reactions_pwy-6475_tiso_add]]
 +
*** Comment: [[reaction added to complete pwy-6475]]
 
== External links  ==
 
== External links  ==
−
* CAS : 320-77-4
+
* RHEA:
−
* CAS : 30810-51-6
+
** [http://www.ebi.ac.uk/rhea/reaction.xhtml?id=30198 30198]
−
* METABOLIGHTS : MTBLC15562
+
{{#set: direction=LEFT-TO-RIGHT}}
−
* PUBCHEM:
+
{{#set: common name=15-cis-phytoene desaturase}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=5459771 5459771]
+
{{#set: common name=phytoene desaturase (ambiguous)|PDS|plant-type phytoene desaturase}}
−
* KNAPSACK : C00001188
+
{{#set: in pathway=PWY-6475}}
−
* HMDB : HMDB01874
+
{{#set: reconstruction category=manual}}
−
* LIGAND-CPD:
+
{{#set: reconstruction source=manual-reactions_pwy-6475_tiso_add}}
−
** [http://www.genome.jp/dbget-bin/www_bget?C00451 C00451]
+
{{#set: reconstruction comment=reaction added to complete pwy-6475}}
−
* CHEMSPIDER:
+
−
** [http://www.chemspider.com/Chemical-Structure.4573553.html 4573553]
+
−
* CHEBI:
+
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=15562 15562]
+
−
* BIGG : icit
+
−
{{#set: smiles=C(=O)(C(CC([O-])=O)C(O)C([O-])=O)[O-]}}
+
−
{{#set: inchi key=InChIKey=ODBLHEXUDAPZAU-ZAFYKAAXSA-K}}
+
−
{{#set: common name=D-threo-isocitrate}}
+
−
{{#set: molecular weight=189.101    }}
+
−
{{#set: common name=D-threo-isocitrate|(1R, 2S)-1-hydroxypropane-1,2,3-tricarboxylate|D-threo-isocitric acid|isocitric acid|isocitrate|threo-Ds-isocitrate|I-CIT|D-isocitrate}}
+
−
{{#set: consumed or produced by=ACONITATEHYDR-RXN|ISOCITDEH-RXN|RXN-14047|ISOCIT-CLEAV-RXN|RXN-9951}}
+

Latest revision as of 20:16, 21 March 2018

Reaction RXN-12244

  • direction:
    • LEFT-TO-RIGHT
  • common name:
    • 15-cis-phytoene desaturase
  • Synonym(s):
    • phytoene desaturase (ambiguous)
    • PDS
    • plant-type phytoene desaturase

Reaction Formula

  • With identifiers:
  • With common name(s):
    • 1 a plastoquinone[c] + 1 15,9'-di-cis-phytofluene[c] => 1 a plastoquinol[c] + 1 9,15,9'-tri-cis-ζ-carotene[c]

Genes associated with this reaction

Pathways

  • PWY-6475, trans-lycopene biosynthesis II (plants): PWY-6475
    • 8 reactions found over 8 reactions in the full pathway

Reconstruction information

External links




Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=RXN-12244&oldid=47372"