Difference between revisions of "RXN-14481"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-13174 CPD-13174] == * smiles: ** C(C1(O)(C(=O)CCC=C1))(OCC2(C(O)=CC=CC=2))=O * inchi key: *...") |
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-14481 RXN-14481] == * direction: ** LEFT-TO-RIGHT * Synonym(s): == Reaction Formula == * With...") |
||
(2 intermediate revisions by the same user not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Reaction]] |
− | == | + | == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-14481 RXN-14481] == |
− | * | + | * direction: |
− | ** | + | ** LEFT-TO-RIGHT |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
* Synonym(s): | * Synonym(s): | ||
− | |||
− | |||
− | |||
− | == Reaction(s) | + | == Reaction Formula == |
− | * [[ | + | * With identifiers: |
− | == | + | ** 1 [[S-ADENOSYLMETHIONINE]][c] '''+''' 1 [[CPD-15360]][c] '''=>''' 1 [[CPD-11592]][c] '''+''' 1 [[PROTON]][c] '''+''' 1 [[ADENOSYL-HOMO-CYS]][c] |
− | == | + | * With common name(s): |
+ | ** 1 S-adenosyl-L-methionine[c] '''+''' 1 2-thio-N6-dimethylallyladenosine37 in tRNA[c] '''=>''' 1 2-methylthio-N6-dimethylallyladenosine37 in tRNA[c] '''+''' 1 H+[c] '''+''' 1 S-adenosyl-L-homocysteine[c] | ||
+ | |||
+ | == Genes associated with this reaction == | ||
+ | Genes have been associated with this reaction based on different elements listed below. | ||
+ | * Gene: [[Tiso_gene_12431]] | ||
+ | ** Source: [[orthology-esiliculosus]] | ||
+ | == Pathways == | ||
+ | == Reconstruction information == | ||
+ | * Category: [[orthology]] | ||
+ | ** Source: [[orthology-esiliculosus]] | ||
+ | *** Tool: [[pantograph]] | ||
== External links == | == External links == | ||
− | + | {{#set: direction=LEFT-TO-RIGHT}} | |
− | + | {{#set: gene associated=Tiso_gene_12431}} | |
− | + | {{#set: in pathway=}} | |
− | {{#set: | + | {{#set: reconstruction category=orthology}} |
− | {{#set: | + | {{#set: reconstruction source=orthology-esiliculosus}} |
− | {{#set: | + | {{#set: reconstruction tool=pantograph}} |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + |
Latest revision as of 20:16, 21 March 2018
Contents
Reaction RXN-14481
- direction:
- LEFT-TO-RIGHT
- Synonym(s):
Reaction Formula
- With identifiers:
- 1 S-ADENOSYLMETHIONINE[c] + 1 CPD-15360[c] => 1 CPD-11592[c] + 1 PROTON[c] + 1 ADENOSYL-HOMO-CYS[c]
- With common name(s):
- 1 S-adenosyl-L-methionine[c] + 1 2-thio-N6-dimethylallyladenosine37 in tRNA[c] => 1 2-methylthio-N6-dimethylallyladenosine37 in tRNA[c] + 1 H+[c] + 1 S-adenosyl-L-homocysteine[c]
Genes associated with this reaction
Genes have been associated with this reaction based on different elements listed below.
- Gene: Tiso_gene_12431
- Source: orthology-esiliculosus
Pathways
Reconstruction information
- Category: orthology
- Source: orthology-esiliculosus
- Tool: pantograph
- Source: orthology-esiliculosus