Difference between revisions of "RXN-11213"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-182 CPD-182] == * smiles: ** CC1(=CC(OC2(C=C(O)C=CC1=2))=O) * inchi key: ** InChIKey=HSHNIT...") |
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-11213 RXN-11213] == * direction: ** LEFT-TO-RIGHT * common name: ** methylmalonate-semialdehyde...") |
||
(2 intermediate revisions by the same user not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Reaction]] |
− | == | + | == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-11213 RXN-11213] == |
− | * | + | * direction: |
− | ** | + | ** LEFT-TO-RIGHT |
− | + | ||
− | + | ||
* common name: | * common name: | ||
− | ** | + | ** methylmalonate-semialdehyde_dehydrogenase |
− | * | + | * ec number: |
− | ** | + | ** [http://enzyme.expasy.org/EC/1.2.1.27 EC-1.2.1.27] |
* Synonym(s): | * Synonym(s): | ||
− | |||
− | == Reaction(s) | + | == Reaction Formula == |
− | == | + | * With identifiers: |
− | * [[ | + | ** 1 [[CO-A]][c] '''+''' 1 [[NAD]][c] '''+''' 1 [[CH3-MALONATE-S-ALD]][c] '''+''' 1 [[WATER]][c] '''=>''' 1 [[NADH]][c] '''+''' 1 [[PROPIONYL-COA]][c] '''+''' 1 [[HCO3]][c] '''+''' 1 [[PROTON]][c] |
− | == | + | * With common name(s): |
+ | ** 1 coenzyme A[c] '''+''' 1 NAD+[c] '''+''' 1 (S)-methylmalonate-semialdehyde[c] '''+''' 1 H2O[c] '''=>''' 1 NADH[c] '''+''' 1 propanoyl-CoA[c] '''+''' 1 hydrogencarbonate[c] '''+''' 1 H+[c] | ||
+ | |||
+ | == Genes associated with this reaction == | ||
+ | Genes have been associated with this reaction based on different elements listed below. | ||
+ | * Gene: [[Tiso_gene_11323]] | ||
+ | ** Source: [[annotation-in-silico_annotation]] | ||
+ | *** Assignment: AUTOMATED-NAME-MATCH | ||
+ | ** Source: [[orthology-esiliculosus]] | ||
+ | == Pathways == | ||
+ | * [[VALDEG-PWY]], L-valine degradation I: [http://metacyc.org/META/NEW-IMAGE?object=VALDEG-PWY VALDEG-PWY] | ||
+ | ** '''8''' reactions found over '''8''' reactions in the full pathway | ||
+ | == Reconstruction information == | ||
+ | * Category: [[orthology]] | ||
+ | ** Source: [[orthology-esiliculosus]] | ||
+ | *** Tool: [[pantograph]] | ||
+ | * Category: [[annotation]] | ||
+ | ** Source: [[annotation-experimental_annotation]] | ||
+ | *** Tool: [[pathwaytools]] | ||
+ | ** Source: [[annotation-in-silico_annotation]] | ||
+ | *** Tool: [[pathwaytools]] | ||
== External links == | == External links == | ||
− | * | + | * RHEA: |
− | + | ** [http://www.ebi.ac.uk/rhea/reaction.xhtml?id=20804 20804] | |
− | + | * LIGAND-RXN: | |
− | ** [http:// | + | ** [http://www.genome.jp/dbget-bin/www_bget?R00935 R00935] |
− | + | {{#set: direction=LEFT-TO-RIGHT}} | |
− | * LIGAND- | + | {{#set: common name=methylmalonate-semialdehyde_dehydrogenase}} |
− | ** [http://www.genome.jp/dbget-bin/www_bget? | + | {{#set: ec number=EC-1.2.1.27}} |
− | + | {{#set: gene associated=Tiso_gene_11323}} | |
− | + | {{#set: in pathway=VALDEG-PWY}} | |
− | + | {{#set: reconstruction category=orthology|annotation}} | |
− | + | {{#set: reconstruction source=annotation-experimental_annotation|annotation-in-silico_annotation|orthology-esiliculosus}} | |
− | + | {{#set: reconstruction tool=pantograph|pathwaytools}} | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + |
Latest revision as of 20:16, 21 March 2018
Contents
Reaction RXN-11213
- direction:
- LEFT-TO-RIGHT
- common name:
- methylmalonate-semialdehyde_dehydrogenase
- ec number:
- Synonym(s):
Reaction Formula
- With identifiers:
- 1 CO-A[c] + 1 NAD[c] + 1 CH3-MALONATE-S-ALD[c] + 1 WATER[c] => 1 NADH[c] + 1 PROPIONYL-COA[c] + 1 HCO3[c] + 1 PROTON[c]
- With common name(s):
- 1 coenzyme A[c] + 1 NAD+[c] + 1 (S)-methylmalonate-semialdehyde[c] + 1 H2O[c] => 1 NADH[c] + 1 propanoyl-CoA[c] + 1 hydrogencarbonate[c] + 1 H+[c]
Genes associated with this reaction
Genes have been associated with this reaction based on different elements listed below.
- Gene: Tiso_gene_11323
- Source: annotation-in-silico_annotation
- Assignment: AUTOMATED-NAME-MATCH
- Source: orthology-esiliculosus
- Source: annotation-in-silico_annotation
Pathways
- VALDEG-PWY, L-valine degradation I: VALDEG-PWY
- 8 reactions found over 8 reactions in the full pathway
Reconstruction information
- Category: orthology
- Source: orthology-esiliculosus
- Tool: pantograph
- Source: orthology-esiliculosus
- Category: annotation
- Source: annotation-experimental_annotation
- Tool: pathwaytools
- Source: annotation-in-silico_annotation
- Tool: pathwaytools
- Source: annotation-experimental_annotation
External links